Input interpretation
L-proline | 1H-purine
Chemical names and formulas
| L-proline | 1H-purine formula | C_5H_9NO_2 | C_5H_4N_4 Hill formula | C_5H_9NO_2 | C_5H_4N_4 name | L-proline | 1H-purine IUPAC name | (2S)-2-pyrrolidinecarboxylic acid | 7H-purine alternate names | (2S)-pyrrolidine-2-carboxylic acid | (S)-pyrrolidine-2-carboxylic acid | 6H-imidazo[4, 5-d]pyrimidine | 7H-imidazo(4, 5-d)pyrimidine | 7H-purine | 9H-purine | purine | purine-ring mass fractions | C (carbon) 52.2% | H (hydrogen) 7.88% | N (nitrogen) 12.2% | O (oxygen) 27.8% | C (carbon) 50% | H (hydrogen) 3.36% | N (nitrogen) 46.6%
Structure diagrams
| L-proline | 1H-purine vertex count | 8 | 9 edge count | 10 | 10 Schultz index | 270 | 390 Wiener index | 62 | 79 Hosoya index | 38 | 91 Balaban index | 2.242 | 1.97
3D structure
3D structure
Basic properties
| L-proline | 1H-purine molar mass | 115.13 g/mol | 120.11 g/mol phase | solid (at STP) | solid (at STP) melting point | 228 °C | 215.5 °C boiling point | 245 °C | 265 °C density | 1.35 g/cm^3 | 1.22 g/cm^3
Units
Hydrophobicity and permeability properties
| L-proline experimental LogP hydrophobicity | -2.4 predicted LogP hydrophobicity | -2.7 predicted LogS | 0.5
Amino acid properties
| L-proline three-letter code | Pro one-letter code | P isoelectric point | 6.3 pK_a (α-COOH, (α-NH_3)^+) | 1.95 | 10.64 polarity | nonpolar codons | CCU | CCC | CCA | CCG occurrence in human proteins | 4.95%
Thermodynamic properties
| 1H-purine molar heat of vaporization | 50.3 kJ/mol (kilojoules per mole) specific heat of vaporization | 0.419 kJ/g (kilojoules per gram) molar heat of combustion | 2709 kJ/mol (kilojoules per mole)
Solid properties (at STP)
| L-proline | 1H-purine density | 1.35 g/cm^3 | 1.22 g/cm^3 vapor pressure | 0.006 mmHg | 0.01 mmHg
Units
Chemical identifiers
| L-proline | 1H-purine CAS number | 147-85-3 | 120-73-0 Beilstein number | 80810 | 3200 PubChem CID number | 145742 | 1044 PubChem SID number | 24901637 | 24898673 SMILES identifier | C1CC(NC1)C(=O)O | C1=C2C(=NC=N1)N=CN2 InChI identifier | InChI=1/C5H9NO2/c7-5(8)4-2-1-3-6-4/h4, 6H, 1-3H2, (H, 7, 8)/t4-/m0/s1/f/h7H | InChI=1/C5H4N4/c1-4-5(8-2-6-1)9-3-7-4/h1-3H, (H, 6, 7, 8, 9)/f/h7H InChI key | ONIBWKKTOPOVIA-XWEZEGGSDT | RTECS number | TW3584000 | UO7450000 MDL number | MFCD00064318 | MFCD00079221