Search

InChI identifier of potassium selenocyanate vs 3-fluoro-4-methylphenylboronic acid

Input interpretation

potassium selenocyanate 3-fluoro-4-methylphenylboronic acid | InChI identifier
potassium selenocyanate 3-fluoro-4-methylphenylboronic acid | InChI identifier

Results

potassium selenocyanate | InChI=1/CHNSe.K/c2-1-3;/h3H;/q;+1/p-1/fCNSe.K/h3h;/q-1;m/rCKNSe/c2-4-1-3 3-fluoro-4-methylphenylboronic acid | InChI=1/C7H8BFO2/c1-5-2-3-6(8(10)11)4-7(5)9/h2-4, 10-11H, 1H3
potassium selenocyanate | InChI=1/CHNSe.K/c2-1-3;/h3H;/q;+1/p-1/fCNSe.K/h3h;/q-1;m/rCKNSe/c2-4-1-3 3-fluoro-4-methylphenylboronic acid | InChI=1/C7H8BFO2/c1-5-2-3-6(8(10)11)4-7(5)9/h2-4, 10-11H, 1H3

Random Queries

density of potassium vs rubidium
net ionic charge of protactinium(V) cation
molecules per unit cell of pyroxene group
formula of phosphotungstic acid hydrate
melting point of aluminum chloride
density of titanium(III) oxide vs phosphorus heptasulfide
formula of chlorine(I) cation vs mercury(II) cation
density of 1-(2,3,4,5,6-pentafluorophenyl)-1-propanol
specific heat of brackish water vs fresh water
half-life of Db-256 vs Pu-231