Input interpretation
cobalt(II) carbonate hydrate | norfloxacin
Chemical names and formulas
| cobalt(II) carbonate hydrate | norfloxacin formula | CoCO_3·xH_2O | C_16H_18FN_3O_3 Hill formula | CH_2CoO_4 | C_16H_18FN_3O_3 name | cobalt(II) carbonate hydrate | norfloxacin IUPAC name | cobaltous carbonate hydrate | 1-ethyl-6-fluoro-4-oxo-7-(2, 3, 5, 6-tetrahydropyrazin-1-yl)quinoline-3-carboxylate alternate names | cobalt(+2) cation carbonate hydrate | cobaltous carbonate hydrate | (none) mass fractions | C (carbon) 8.77% | Co (cobalt) 43% | H (hydrogen) 1.47% | O (oxygen) 46.7% | C (carbon) 60.2% | F (fluorine) 5.95% | H (hydrogen) 5.68% | N (nitrogen) 13.2% | O (oxygen) 15%
Structure diagrams
Structure diagrams
3D structure
3D structure
Basic properties
| cobalt(II) carbonate hydrate | norfloxacin molar mass | 136.96 g/mol | 319.34 g/mol phase | | solid (at STP) melting point | | 228 °C boiling point | | 556 °C density | 4.13 g/cm^3 | solubility in water | | soluble
Units
Hydrophobicity and permeability properties
| norfloxacin experimental LogP hydrophobicity | 2.1 predicted LogP hydrophobicity | -0.46 predicted LogS | -2.5
Drug interactions
norfloxacin | acenocoumarol | aluminum | aminophylline | anisindione | bismuth | caffeine | calcium | clozapine | cyclosporin A | dicumarol | 7-(2, 3-dihydroxypropyl)theophylline | foscarnet | iron | magnesium | magnesium oxide | oxtriphylline | sucralfate | theophylline | warfarin | zinc (total: 20)
Thermodynamic properties
| norfloxacin molar heat of vaporization | 88.1 kJ/mol (kilojoules per mole) specific heat of vaporization | 0.276 kJ/g (kilojoules per gram)
Solid properties
| norfloxacin vapor pressure | 3×10^-13 mmHg
Units
Chemical identifiers
![| cobalt(II) carbonate hydrate | norfloxacin CAS number | 57454-67-8 | 70458-96-7 Beilstein number | | 567897 PubChem CID number | 16211458 | 6919051 PubChem SID number | 24852047 | 8912 SMILES identifier | C(=O)([O-])[O-].O.[Co+2] | CCN1C=C(C(=O)C2=CC(=C(C=C21)N3CC[NH2+]CC3)F)C(=O)[O-] InChI identifier | InChI=1/CH2O3.Co.H2O/c2-1(3)4;;/h(H2, 2, 3, 4);;1H2/q;+2;/p-2/fCO3.Co.H2O/q-2;m; | InChI=1/C16H18FN3O3/c1-2-19-9-11(16(22)23)15(21)10-7-12(17)14(8-13(10)19)20-5-3-18-4-6-20/h7-9, 18H, 2-6H2, 1H3, (H, 22, 23)/f/h18H InChI key | | OGJPXUAPXNRGGI-QWOVJGMICW EU number | | 274-614-4 RTECS number | | VB2005000 MDL number | MFCD00149654 |](../image_source/866720f39073150806b7a81c2d408954.png)
| cobalt(II) carbonate hydrate | norfloxacin CAS number | 57454-67-8 | 70458-96-7 Beilstein number | | 567897 PubChem CID number | 16211458 | 6919051 PubChem SID number | 24852047 | 8912 SMILES identifier | C(=O)([O-])[O-].O.[Co+2] | CCN1C=C(C(=O)C2=CC(=C(C=C21)N3CC[NH2+]CC3)F)C(=O)[O-] InChI identifier | InChI=1/CH2O3.Co.H2O/c2-1(3)4;;/h(H2, 2, 3, 4);;1H2/q;+2;/p-2/fCO3.Co.H2O/q-2;m; | InChI=1/C16H18FN3O3/c1-2-19-9-11(16(22)23)15(21)10-7-12(17)14(8-13(10)19)20-5-3-18-4-6-20/h7-9, 18H, 2-6H2, 1H3, (H, 22, 23)/f/h18H InChI key | | OGJPXUAPXNRGGI-QWOVJGMICW EU number | | 274-614-4 RTECS number | | VB2005000 MDL number | MFCD00149654 |