Search

cesium chlorate

Input interpretation

cesium chlorate
cesium chlorate

Chemical names and formulas

formula | CsClO_3 Hill formula | ClCsO_3 name | cesium chlorate mass fractions | Cl (chlorine) 16.4% | Cs (cesium) 61.4% | O (oxygen) 22.2%
formula | CsClO_3 Hill formula | ClCsO_3 name | cesium chlorate mass fractions | Cl (chlorine) 16.4% | Cs (cesium) 61.4% | O (oxygen) 22.2%

Structure diagram

Structure diagram
Structure diagram
vertex count | 5 edge count | 3 Schultz index | 36 Wiener index | 9 Hosoya index | 4 Balaban index | 2.324
vertex count | 5 edge count | 3 Schultz index | 36 Wiener index | 9 Hosoya index | 4 Balaban index | 2.324

Basic properties

molar mass | 216.35 g/mol
molar mass | 216.35 g/mol

Units

Chemical identifiers

PubChem CID number | 23685553 SMILES identifier | [O-]Cl(=O)=O.[Cs+] InChI identifier | InChI=1/ClHO3.Cs/c2-1(3)4;/h(H, 2, 3, 4);/q;+1/p-1/fClO3.Cs/q-1;m
PubChem CID number | 23685553 SMILES identifier | [O-]Cl(=O)=O.[Cs+] InChI identifier | InChI=1/ClHO3.Cs/c2-1(3)4;/h(H, 2, 3, 4);/q;+1/p-1/fClO3.Cs/q-1;m

Random Queries

short electronic configuration of synthetic elements
IUPAC name of methylmagnesium iodide vs lithium diethylamide
bond energies of (5z,9e,14z)-(8xi,11xi,12s)-8,11,12-trihydroxyicosa-5,9,14-trienoate
color of ytterbium vs erbium
formula of barium cation vs lithium cation
net ionic charge of hexachloroplatinate(IV) anion vs pentaamminechlorocobalt(II) cation
empirical formula of butane-d 10 vs propane-2,2-d 2
formula of stibine vs diphosphorous tetraiodide
density of periodic acid vs pyrophosphoric acid
CAS number of cesium perchlorate