Input interpretation
boron carbide
Chemical names and formulas
formula | B_4C Hill formula | CB_4 name | boron carbide alternate names | carbon tetraboride mass fractions | B (boron) 78.3% | C (carbon) 21.7%
Lewis structure
Draw the Lewis structure of boron carbide. Start by drawing the overall structure of the molecule: Count the total valence electrons of the boron (n_B, val = 3) and carbon (n_C, val = 4) atoms: 4 n_B, val + n_C, val = 16 Calculate the number of electrons needed to completely fill the valence shells for boron (n_B, full = 6) and carbon (n_C, full = 8): 4 n_B, full + n_C, full = 32 Subtracting these two numbers shows that 32 - 16 = 16 bonding electrons are needed. Each bond has two electrons, so the above diagram has all the necessary bonds. There are 8 bonds and hence 16 bonding electrons in the diagram. Lastly, fill in the remaining unbonded electrons on each atom. In total, there remain 16 - 16 = 0 electrons left to draw and the diagram is complete: Answer: | |
Basic properties
molar mass | 55.25 g/mol phase | solid (at STP) melting point | 2350 °C boiling point | 3500 °C density | 2.51 g/cm^3 solubility in water | insoluble
Units
Solid properties (at STP)
density | 2.51 g/cm^3
Units
Chemical identifiers
CAS number | 12069-32-8 PubChem CID number | 123279 SMILES identifier | B12B3C14B2B43 InChI identifier | InChI=1/CB4/c2-1-3(2)5(1)4(1)2 MDL number | MFCD00011520
Toxicity properties
odor | odorless