Input interpretation
acetoxime
Chemical names and formulas
formula | (CH_3)_2C=NOH Hill formula | C_3H_7NO name | acetoxime IUPAC name | propan-2-one oxime alternate names | 2-propanone, oxime | 2-propanone oxime | acetone, oxime | acetonoxime | N-propan-2-ylidenehydroxylamine | propan-2-one oxime mass fractions | C (carbon) 49.3% | H (hydrogen) 9.65% | N (nitrogen) 19.2% | O (oxygen) 21.9%
Lewis structure
Draw the Lewis structure of acetoxime. Start by drawing the overall structure of the molecule, ignoring potential double and triple bonds: Count the total valence electrons of the carbon (n_C, val = 4), hydrogen (n_H, val = 1), nitrogen (n_N, val = 5), and oxygen (n_O, val = 6) atoms: 3 n_C, val + 7 n_H, val + n_N, val + n_O, val = 30 Calculate the number of electrons needed to completely fill the valence shells for carbon (n_C, full = 8), hydrogen (n_H, full = 2), nitrogen (n_N, full = 8), and oxygen (n_O, full = 8): 3 n_C, full + 7 n_H, full + n_N, full + n_O, full = 54 Subtracting these two numbers shows that 54 - 30 = 24 bonding electrons are needed. Each bond has two electrons, so in addition to the 11 bonds already present in the diagram add 1 bond. To minimize formal charge nitrogen wants 3 bonds and carbon wants 4 bonds. Identify the atoms that want additional bonds and the number of electrons remaining on each atom: Fill in the 1 bond by pairing electrons between adjacent highlighted atoms: Answer: | |
3D structure
3D structure
Basic properties
molar mass | 73.1 g/mol phase | solid (at STP) melting point | 61.5 °C boiling point | 135 °C density | 0.901 g/cm^3 solubility in water | very soluble
Units
Solid properties (at STP)
density | 0.901 g/cm^3 vapor pressure | 4.7 mmHg (at 25 °C) refractive index | 1.4118
Units
Thermodynamic properties
molar heat of vaporization | 41.1 kJ/mol specific heat of vaporization | 0.562 kJ/g (at STP)
Chemical identifiers
CAS number | 127-06-0 Beilstein number | 1560146 PubChem CID number | 67180 PubChem SID number | 24890499 SMILES identifier | CC(=NO)C InChI identifier | InChI=1/C3H7NO/c1-3(2)4-5/h5H, 1-2H3 RTECS number | AL6825000 MDL number | MFCD00002118
NFPA label
NFPA label
NFPA health rating | 2 NFPA fire rating | 0 NFPA reactivity rating | 0
Safety properties
flash point | 45 °C
DOT numbers | 1325
Toxicity properties
RTECS classes | other