Search

DOT mercury(I) chloride

Input interpretation

sodium bromate | mercury(I) chloride
sodium bromate | mercury(I) chloride

Chemical names and formulas

 | sodium bromate | mercury(I) chloride formula | NaBrO_3 | Hg_2Cl_2 Hill formula | BrNaO_3 | Cl_2Hg_2 name | sodium bromate | mercury(I) chloride IUPAC name | sodium bromate | chloromercury alternate names | DOT | dyetone | calomel | chloromercury | cyclosan | dimercury dichloride | mercurous chloride | mercury subchloride mass fractions | Br (bromine) 53% | Na (sodium) 15.2% | O (oxygen) 31.8% | Cl (chlorine) 15% | Hg (mercury) 85%
| sodium bromate | mercury(I) chloride formula | NaBrO_3 | Hg_2Cl_2 Hill formula | BrNaO_3 | Cl_2Hg_2 name | sodium bromate | mercury(I) chloride IUPAC name | sodium bromate | chloromercury alternate names | DOT | dyetone | calomel | chloromercury | cyclosan | dimercury dichloride | mercurous chloride | mercury subchloride mass fractions | Br (bromine) 53% | Na (sodium) 15.2% | O (oxygen) 31.8% | Cl (chlorine) 15% | Hg (mercury) 85%

Structure diagrams

  | sodium bromate | mercury(I) chloride vertex count | 5 | 4 edge count | 3 | 3 Schultz index | 36 | 38 Wiener index | 9 | 10 Hosoya index | 4 | 5 Balaban index | 2.324 | 1.975
| sodium bromate | mercury(I) chloride vertex count | 5 | 4 edge count | 3 | 3 Schultz index | 36 | 38 Wiener index | 9 | 10 Hosoya index | 4 | 5 Balaban index | 2.324 | 1.975

Basic properties

 | sodium bromate | mercury(I) chloride molar mass | 150.89 g/mol | 472.08 g/mol phase | solid (at STP) | solid (at STP) melting point | 381 °C | 525 °C boiling point | 1390 °C | 383 °C density | 3.339 g/cm^3 | 7.16 g/cm^3 solubility in water | soluble | insoluble
| sodium bromate | mercury(I) chloride molar mass | 150.89 g/mol | 472.08 g/mol phase | solid (at STP) | solid (at STP) melting point | 381 °C | 525 °C boiling point | 1390 °C | 383 °C density | 3.339 g/cm^3 | 7.16 g/cm^3 solubility in water | soluble | insoluble

Units

Thermodynamic properties

 | sodium bromate | mercury(I) chloride molar heat of fusion | 28.11 kJ/mol (kilojoules per mole) | 15.1 kJ/mol (kilojoules per mole) specific heat of fusion | 0.1863 kJ/g (kilojoules per gram) | 0.03199 kJ/g (kilojoules per gram)
| sodium bromate | mercury(I) chloride molar heat of fusion | 28.11 kJ/mol (kilojoules per mole) | 15.1 kJ/mol (kilojoules per mole) specific heat of fusion | 0.1863 kJ/g (kilojoules per gram) | 0.03199 kJ/g (kilojoules per gram)

Solid properties (at STP)

 | sodium bromate | mercury(I) chloride density | 3.339 g/cm^3 | 7.16 g/cm^3 vapor pressure | | 1×10^-4 mmHg
| sodium bromate | mercury(I) chloride density | 3.339 g/cm^3 | 7.16 g/cm^3 vapor pressure | | 1×10^-4 mmHg

Units

Chemical identifiers

 | sodium bromate | mercury(I) chloride CAS number | 7789-38-0 | 10112-91-1 PubChem CID number | 23668195 | 24956 PubChem SID number | 24853461 | 24868461 SMILES identifier | [O-]Br(=O)=O.[Na+] | Cl[Hg].Cl[Hg] InChI identifier | InChI=1/BrHO3.Na/c2-1(3)4;/h(H, 2, 3, 4);/q;+1/p-1/fBrO3.Na/q-1;m | InChI=1/2ClH.2Hg/h2*1H;;/q;;2*+1/p-2/f2Cl.2Hg/h2*1h;;/q2*-1;2m EU number | | 231-430-9 Gmelin number | | 37841 RTECS number | EF8750000 | OV8740000 MDL number | MFCD00003476 | MFCD00011043
| sodium bromate | mercury(I) chloride CAS number | 7789-38-0 | 10112-91-1 PubChem CID number | 23668195 | 24956 PubChem SID number | 24853461 | 24868461 SMILES identifier | [O-]Br(=O)=O.[Na+] | Cl[Hg].Cl[Hg] InChI identifier | InChI=1/BrHO3.Na/c2-1(3)4;/h(H, 2, 3, 4);/q;+1/p-1/fBrO3.Na/q-1;m | InChI=1/2ClH.2Hg/h2*1H;;/q;;2*+1/p-2/f2Cl.2Hg/h2*1h;;/q2*-1;2m EU number | | 231-430-9 Gmelin number | | 37841 RTECS number | EF8750000 | OV8740000 MDL number | MFCD00003476 | MFCD00011043

NFPA label

NFPA label
NFPA label
 | sodium bromate | mercury(I) chloride NFPA health rating | | 2 NFPA fire rating | | 0 NFPA reactivity rating | | 0 NFPA hazards | oxidizing agent |
| sodium bromate | mercury(I) chloride NFPA health rating | | 2 NFPA fire rating | | 0 NFPA reactivity rating | | 0 NFPA hazards | oxidizing agent |

Safety properties

 | sodium bromate flash point | 381 °C
| sodium bromate flash point | 381 °C
 | sodium bromate | mercury(I) chloride DOT hazard class | 5.1 | 6.1 DOT numbers | 1494 | 2025
| sodium bromate | mercury(I) chloride DOT hazard class | 5.1 | 6.1 DOT numbers | 1494 | 2025