Input interpretation
sodium bichromate
Chemical names and formulas
formula | Na_2Cr_2O_7 Hill formula | Cr_2Na_2O_7 name | sodium bichromate IUPAC name | disodium oxido-(oxido-dioxo-chromio)oxy-dioxo-chromium alternate names | anhydrous sodium dichromate | chromic acid, disodium salt | sodium dichromate mass fractions | Cr (chromium) 39.7% | Na (sodium) 17.6% | O (oxygen) 42.8%
Structure diagram
Structure diagram
vertex count | 11 edge count | 8 Schultz index | 322 Wiener index | 88 Hosoya index | 24 Balaban index | 3.746
Basic properties
molar mass | 261.96 g/mol phase | solid (at STP) melting point | 356.7 °C density | 2.35 g/cm^3
Units
Solid properties (at STP)
density | 2.35 g/cm^3
Units
Thermodynamic properties
molar heat of fusion | 35.7 kJ/mol specific heat of fusion | 0.1363 kJ/g (at STP)
Chemical identifiers
CAS number | 10588-01-9 PubChem CID number | 25408 SMILES identifier | [O-][Cr](=O)(=O)O[Cr](=O)(=O)[O-].[Na+].[Na+] InChI identifier | InChI=1/2Cr.2Na.7O/q;;2*+1;;;;;;2*-1/rCr2O7.2Na/c3-1(4, 5)9-2(6, 7)8;;/q-2;2*+1 EU number | 234-190-3 Gmelin number | 21597 RTECS number | HX7700000
NFPA label
NFPA label
NFPA health rating | 3 NFPA fire rating | 0 NFPA reactivity rating | 0 NFPA hazards | oxidizing agent
Toxicity properties
lethal dosage | 50 mg/kg (oral dose for rats)
probable lethal dose for man | 4 mL (milliliters) RTECS classes | tumorigen | mutagen | reproductive effector | human data
Ion equivalents
(Cr_2O_7)^(2-) (dichromate anion) | 1 Na^+ (sodium cation) | 2