Search

name of cupferron chemical

Input interpretation

cupferron
cupferron

Chemical names and formulas

formula | C_6H_5N(NO)ONH_4 Hill formula | C_6H_9N_3O_2 name | cupferron IUPAC name | ammonium N-oxido-N-phenylnitrous amide alternate names | ammonium cupferron | ammonium N-nitrosophenylhydroxylamine | ammonium N-oxido-N-phenyl-nitrous amide | azanium N-oxido-N-phenyl-nitrous amide | azanium N-oxido-N-phenylnitrous amide | cupferron, ammonium salt | kupferon | N-nitroso-N-phenylhydroxylamine ammonium salt mass fractions | C (carbon) 46.4% | H (hydrogen) 5.85% | N (nitrogen) 27.1% | O (oxygen) 20.6%
formula | C_6H_5N(NO)ONH_4 Hill formula | C_6H_9N_3O_2 name | cupferron IUPAC name | ammonium N-oxido-N-phenylnitrous amide alternate names | ammonium cupferron | ammonium N-nitrosophenylhydroxylamine | ammonium N-oxido-N-phenyl-nitrous amide | azanium N-oxido-N-phenyl-nitrous amide | azanium N-oxido-N-phenylnitrous amide | cupferron, ammonium salt | kupferon | N-nitroso-N-phenylhydroxylamine ammonium salt mass fractions | C (carbon) 46.4% | H (hydrogen) 5.85% | N (nitrogen) 27.1% | O (oxygen) 20.6%

Structure diagram

Structure diagram
Structure diagram

Basic properties

molar mass | 155.16 g/mol phase | solid (at STP) melting point | 152.5 °C solubility in water | soluble
molar mass | 155.16 g/mol phase | solid (at STP) melting point | 152.5 °C solubility in water | soluble

Units

Chemical identifiers

CAS number | 135-20-6 Beilstein number | 3919107 PubChem CID number | 2724103 PubChem SID number | 24885293 SMILES identifier | C1=CC=C(C=C1)N(N=O)[O-].[NH4+] InChI identifier | InChI=1/C6H5N2O2.H3N/c9-7-8(10)6-4-2-1-3-5-6;/h1-5H;1H3/q-1;/p+1/fC6H5N2O2.H4N/h;1H/qm;+1 RTECS number | NC4725000 MDL number | MFCD00078422
CAS number | 135-20-6 Beilstein number | 3919107 PubChem CID number | 2724103 PubChem SID number | 24885293 SMILES identifier | C1=CC=C(C=C1)N(N=O)[O-].[NH4+] InChI identifier | InChI=1/C6H5N2O2.H3N/c9-7-8(10)6-4-2-1-3-5-6;/h1-5H;1H3/q-1;/p+1/fC6H5N2O2.H4N/h;1H/qm;+1 RTECS number | NC4725000 MDL number | MFCD00078422

NFPA label

NFPA label
NFPA label
NFPA health rating | 2 NFPA fire rating | 0 NFPA reactivity rating | 0
NFPA health rating | 2 NFPA fire rating | 0 NFPA reactivity rating | 0

Toxicity properties

RTECS classes | agricultural chemical and pesticide | tumorigen | mutagen | primary irritant
RTECS classes | agricultural chemical and pesticide | tumorigen | mutagen | primary irritant

Random Queries

freezing point of plaster of paris
alternate names of bismuth cation
H2O + O2 + Fe(HCO3)2 = CO2 + Fe(OH)3
brand names of lithium
chemical types 3-(1-methyl-2-pyrrolidinyl)pyridine
Mohs hardness of zinc vs nickel
molar mass of 3,5-bis(trifluoromethyl)benzaldehyde
molar mass of chloride anion vs phosphate anion
formula of tetrabromophenolphthalein ethyl ester
chemical types of argon