Search

InChI identifier of D-(+)-glucose

Input interpretation

D-(+)-glucose | InChI identifier
D-(+)-glucose | InChI identifier

Result

InChI=1/C6H12O6/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-11H, 1H2
InChI=1/C6H12O6/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-11H, 1H2

Random Queries

SO2 + MnO2 = MnS2O6
boiling point of o-dichlorobenzene
structure diagram of chromium(II) cation vs oxide anion
freezing point of N-butylcyclohexane vs 3-ethyl-o-xylene
atomic diameter of krypton vs oxygen
total number of valence electrons of oxygen(I) cation
number of protons of period 1 elements
formula of moolooite
Brewster's angle
SnCl2 + AuCl3 = Au + SnCl4