Search

name of thenyldiamine hydrochloride

Input interpretation

thenyldiamine hydrochloride
thenyldiamine hydrochloride

Chemical names and formulas

formula | C_14H_20ClN_3S name | thenyldiamine hydrochloride IUPAC name | dimethyl-[2-(pyridin-2-yl-(thiophen-3-ylmethyl)amino)ethyl]azanium chloride alternate names | dethylandiamine mass fractions | C (carbon) 56.5% | Cl (chlorine) 11.9% | H (hydrogen) 6.77% | N (nitrogen) 14.1% | S (sulfur) 10.8%
formula | C_14H_20ClN_3S name | thenyldiamine hydrochloride IUPAC name | dimethyl-[2-(pyridin-2-yl-(thiophen-3-ylmethyl)amino)ethyl]azanium chloride alternate names | dethylandiamine mass fractions | C (carbon) 56.5% | Cl (chlorine) 11.9% | H (hydrogen) 6.77% | N (nitrogen) 14.1% | S (sulfur) 10.8%

Structure diagram

Structure diagram
Structure diagram
vertex count | 19 edge count | 20 Schultz index | 2684 Wiener index | 637 Hosoya index | 5450 Balaban index | 1.83
vertex count | 19 edge count | 20 Schultz index | 2684 Wiener index | 637 Hosoya index | 5450 Balaban index | 1.83

Basic properties

molar mass | 297.8 g/mol phase | solid (at STP) melting point | 169.8 °C
molar mass | 297.8 g/mol phase | solid (at STP) melting point | 169.8 °C

Units

Chemical identifiers

CAS number | 958-93-0 Beilstein number | 6099167 PubChem CID number | 13734 SMILES identifier | C[NH+](C)CCN(CC1=CSC=C1)C2=CC=CC=N2.[Cl-] InChI identifier | InChI=1/C14H19N3S.ClH/c1-16(2)8-9-17(11-13-6-10-18-12-13)14-5-3-4-7-15-14;/h3-7, 10, 12H, 8-9, 11H2, 1-2H3;1H/fC14H20N3S.Cl/h16H;1h/q+1;-1 EU number | 213-490-8 RTECS number | UT1925000
CAS number | 958-93-0 Beilstein number | 6099167 PubChem CID number | 13734 SMILES identifier | C[NH+](C)CCN(CC1=CSC=C1)C2=CC=CC=N2.[Cl-] InChI identifier | InChI=1/C14H19N3S.ClH/c1-16(2)8-9-17(11-13-6-10-18-12-13)14-5-3-4-7-15-14;/h3-7, 10, 12H, 8-9, 11H2, 1-2H3;1H/fC14H20N3S.Cl/h16H;1h/q+1;-1 EU number | 213-490-8 RTECS number | UT1925000

Toxicity properties

RTECS classes | drug
RTECS classes | drug