Search

2-(trifluoromethoxy)iodobenzene

Input interpretation

2-(trifluoromethoxy)iodobenzene
2-(trifluoromethoxy)iodobenzene

Chemical names and formulas

formula | C_6H_4IOCF_3 Hill formula | C_7H_4F_3IO name | 2-(trifluoromethoxy)iodobenzene IUPAC name | 1-iodo-2-(trifluoromethoxy)benzene alternate names | 1-iodo-2-(trifluoromethoxy)benzene mass fractions | C (carbon) 29.2% | F (fluorine) 19.8% | H (hydrogen) 1.4% | I (iodine) 44.1% | O (oxygen) 5.56%
formula | C_6H_4IOCF_3 Hill formula | C_7H_4F_3IO name | 2-(trifluoromethoxy)iodobenzene IUPAC name | 1-iodo-2-(trifluoromethoxy)benzene alternate names | 1-iodo-2-(trifluoromethoxy)benzene mass fractions | C (carbon) 29.2% | F (fluorine) 19.8% | H (hydrogen) 1.4% | I (iodine) 44.1% | O (oxygen) 5.56%

Lewis structure

Draw the Lewis structure of 2-(trifluoromethoxy)iodobenzene. Start by drawing the overall structure of the molecule, ignoring potential double and triple bonds:  Count the total valence electrons of the carbon (n_C, val = 4), fluorine (n_F, val = 7), hydrogen (n_H, val = 1), iodine (n_I, val = 7), and oxygen (n_O, val = 6) atoms: 7 n_C, val + 3 n_F, val + 4 n_H, val + n_I, val + n_O, val = 66 Calculate the number of electrons needed to completely fill the valence shells for carbon (n_C, full = 8), fluorine (n_F, full = 8), hydrogen (n_H, full = 2), iodine (n_I, full = 8), and oxygen (n_O, full = 8): 7 n_C, full + 3 n_F, full + 4 n_H, full + n_I, full + n_O, full = 104 Subtracting these two numbers shows that 104 - 66 = 38 bonding electrons are needed. Each bond has two electrons, so in addition to the 16 bonds already present in the diagram add 3 bonds. To minimize formal charge carbon wants 4 bonds. Identify the atoms that want additional bonds and the number of electrons remaining on each atom:  Fill in the 3 bonds by pairing electrons between adjacent highlighted atoms. Note that the six atom ring is aromatic, so that the single and double bonds may be rearranged: Answer: |   |
Draw the Lewis structure of 2-(trifluoromethoxy)iodobenzene. Start by drawing the overall structure of the molecule, ignoring potential double and triple bonds: Count the total valence electrons of the carbon (n_C, val = 4), fluorine (n_F, val = 7), hydrogen (n_H, val = 1), iodine (n_I, val = 7), and oxygen (n_O, val = 6) atoms: 7 n_C, val + 3 n_F, val + 4 n_H, val + n_I, val + n_O, val = 66 Calculate the number of electrons needed to completely fill the valence shells for carbon (n_C, full = 8), fluorine (n_F, full = 8), hydrogen (n_H, full = 2), iodine (n_I, full = 8), and oxygen (n_O, full = 8): 7 n_C, full + 3 n_F, full + 4 n_H, full + n_I, full + n_O, full = 104 Subtracting these two numbers shows that 104 - 66 = 38 bonding electrons are needed. Each bond has two electrons, so in addition to the 16 bonds already present in the diagram add 3 bonds. To minimize formal charge carbon wants 4 bonds. Identify the atoms that want additional bonds and the number of electrons remaining on each atom: Fill in the 3 bonds by pairing electrons between adjacent highlighted atoms. Note that the six atom ring is aromatic, so that the single and double bonds may be rearranged: Answer: | |

3D structure

3D structure
3D structure

Basic properties

molar mass | 288.01 g/mol phase | liquid (at STP) boiling point | 164.5 °C density | 1.855 g/cm^3
molar mass | 288.01 g/mol phase | liquid (at STP) boiling point | 164.5 °C density | 1.855 g/cm^3

Units

Liquid properties (at STP)

density | 1.855 g/cm^3 refractive index | 1.506
density | 1.855 g/cm^3 refractive index | 1.506

Units

Chemical identifiers

CAS number | 175278-00-9 PubChem CID number | 2777292 PubChem SID number | 24879396 SMILES identifier | C1=CC=C(C(=C1)OC(F)(F)F)I InChI identifier | InChI=1/C7H4F3IO/c8-7(9, 10)12-6-4-2-1-3-5(6)11/h1-4H MDL number | MFCD00042410
CAS number | 175278-00-9 PubChem CID number | 2777292 PubChem SID number | 24879396 SMILES identifier | C1=CC=C(C(=C1)OC(F)(F)F)I InChI identifier | InChI=1/C7H4F3IO/c8-7(9, 10)12-6-4-2-1-3-5(6)11/h1-4H MDL number | MFCD00042410

Safety properties

flash point | 65.56 °C
flash point | 65.56 °C