Input interpretation
sodium bicarbonate
Chemical names and formulas
formula | NaHCO_3 Hill formula | CHNaO_3 name | sodium bicarbonate IUPAC name | sodium hydrogen carbonate alternate names | baking soda mass fractions | C (carbon) 14.3% | H (hydrogen) 1.2% | Na (sodium) 27.4% | O (oxygen) 57.1%
Structure diagram
Structure diagram
vertex count | 5 edge count | 4 Schultz index | 36 Wiener index | 9 Hosoya index | 4 Balaban index | 2.324
Basic properties
molar mass | 84.006 g/mol phase | solid (at STP) melting point | 270 °C density | 2.16 g/cm^3 solubility in water | soluble
Units
Hydrophobicity and permeability properties
predicted LogP hydrophobicity | -0.05 predicted LogS | 0.96
Basic drug properties
approval status | approved | small molecule drug categories | antidiarrheal dosage forms | oral: liquid | oral: powder | intravenous: solution | oral: solution / drops | oral: tablet
brand names | 800 sodium bicarbonate powder | acidosan | BSS plus | baros | citrocarbonate | Co-lav | colovage | colyte | E-Z-EM prep lyte | elliotts B solution | endosol extra | glycoprep | Go-evac | golytely | gripe water | hema BP-38 | meylon | natrum bicarbonicum | neut | nulytely | OCL | peg-lyte | sandoz sodium bicarbonate | sodium bicarbonate in plastic container | sodium bicarbonate liquid concentrate
Solid properties (at STP)
density | 2.16 g/cm^3 vapor pressure | 7315 mmHg (at 100 °C)
Units
Thermodynamic properties
specific heat capacity c_p | solid | 1.043 J/(g K) molar heat capacity c_p | solid | 87.6 J/(mol K) specific free energy of formation Δ_fG° | solid | -10.13 kJ/g molar free energy of formation Δ_fG° | solid | -851 kJ/mol specific heat of formation Δ_fH° | solid | -11.32 kJ/g molar heat of formation Δ_fH° | solid | -950.8 kJ/mol specific entropy S° | solid | 1.214 J/(g K) molar entropy S° | solid | 102 J/(mol K) molar heat of fusion | 25 kJ/mol | specific heat of fusion | 0.3 kJ/g | (at STP)
Chemical identifiers
![CAS number | 144-55-8 Beilstein number | 4153970 PubChem CID number | 516892 PubChem SID number | 7848266 SMILES identifier | C(=O)(O)[O-].[Na+] InChI identifier | InChI=1/CH2O3.Na/c2-1(3)4;/h(H2, 2, 3, 4);/q;+1/p-1/fCHO3.Na/h2H;/q-1;m InChI key | UIIMBOGNXHQVGW-PAJBJYNQCH RTECS number | VZ0950000 MDL number | MFCD00003528](../image_source/06aee7e8d03315ddf15e97916c3cd9e3.png)
CAS number | 144-55-8 Beilstein number | 4153970 PubChem CID number | 516892 PubChem SID number | 7848266 SMILES identifier | C(=O)(O)[O-].[Na+] InChI identifier | InChI=1/CH2O3.Na/c2-1(3)4;/h(H2, 2, 3, 4);/q;+1/p-1/fCHO3.Na/h2H;/q-1;m InChI key | UIIMBOGNXHQVGW-PAJBJYNQCH RTECS number | VZ0950000 MDL number | MFCD00003528
NFPA label
NFPA label
NFPA health rating | 2 NFPA fire rating | 0 NFPA reactivity rating | 0
Toxicity properties
odor | odorless lethal dosage | 4220 mg/kg (oral dose for rats)
probable lethal dose for man | 600 mL (milliliters) RTECS classes | mutagen | reproductive effector | human data | primary irritant
Ion equivalents
Na^+ (sodium cation) | 1 (HCO_3)^- (hydrogen carbonate anion) | 1