Input interpretation
3-(diethylamino)phenol
Chemical names and formulas
formula | (C_2H_5)_2NC_6H_4OH Hill formula | C_10H_15NO name | 3-(diethylamino)phenol IUPAC name | 3-diethylaminophenol alternate names | 3-diethylaminophenol | 3-hydroxy-N, N-diethylaniline | m-(diethylamino)phenol | N, N-diethyl-3-aminophenol | N, N-diethyl-m-aminophenol | phenol, m-(diethylamino)- mass fractions | C (carbon) 72.7% | H (hydrogen) 9.15% | N (nitrogen) 8.48% | O (oxygen) 9.68%
Lewis structure
Draw the Lewis structure of 3-(diethylamino)phenol. Start by drawing the overall structure of the molecule, ignoring potential double and triple bonds: Count the total valence electrons of the carbon (n_C, val = 4), hydrogen (n_H, val = 1), nitrogen (n_N, val = 5), and oxygen (n_O, val = 6) atoms: 10 n_C, val + 15 n_H, val + n_N, val + n_O, val = 66 Calculate the number of electrons needed to completely fill the valence shells for carbon (n_C, full = 8), hydrogen (n_H, full = 2), nitrogen (n_N, full = 8), and oxygen (n_O, full = 8): 10 n_C, full + 15 n_H, full + n_N, full + n_O, full = 126 Subtracting these two numbers shows that 126 - 66 = 60 bonding electrons are needed. Each bond has two electrons, so in addition to the 27 bonds already present in the diagram add 3 bonds. To minimize formal charge carbon wants 4 bonds. Identify the atoms that want additional bonds and the number of electrons remaining on each atom: Fill in the 3 bonds by pairing electrons between adjacent highlighted atoms. Note that the six atom ring is aromatic, so that the single and double bonds may be rearranged: Answer: | |
3D structure
3D structure
Basic properties
molar mass | 165.24 g/mol phase | solid (at STP) melting point | 70.5 °C boiling point | 170 °C (measured at 2000 Pa) solubility in water | insoluble
Units
Solid properties (at STP)
vapor pressure | 0.003 mmHg (at 25 °C)
Units
Thermodynamic properties
molar heat of vaporization | 53.7 kJ/mol specific heat of vaporization | 0.325 kJ/g (at STP)
Chemical identifiers
CAS number | 91-68-9 Beilstein number | 908212 PubChem CID number | 7062 PubChem SID number | 24846564 SMILES identifier | CCN(CC)C1=CC(=CC=C1)O InChI identifier | InChI=1/C10H15NO/c1-3-11(4-2)9-6-5-7-10(12)8-9/h5-8, 12H, 3-4H2, 1-2H3 RTECS number | SL0550500 MDL number | MFCD00002265
NFPA label
NFPA label
NFPA health rating | 2 NFPA fire rating | 1 NFPA reactivity rating | 0
Safety properties
flash point | 141 °C
DOT hazard class | 6.1 DOT numbers | 2512
Toxicity properties
RTECS classes | mutagen