Input interpretation
2, 4-dimethylstyrene | orbital hybridization
Result
First draw the structure diagram for 2, 4-dimethylstyrene, and for every non-hydrogen atom, count the σ-bonds. Note that double and triple bonds consist of one σ-bond together with one or two π-bonds: For 2, 4-dimethylstyrene there are no lone pairs, so the steric number is given by the σ-bond count. Consult the following chart to determine the hybridization from the steric number: steric number | hybridization 2 | sp 3 | sp^2 4 | sp^3 5 | dsp^3 6 | d^2sp^3 7 | d^3sp^3 Now assign the hybridization for each atom: Answer: | |
Basic properties
molar mass | 132.2 g/mol formula | C_10H_12 empirical formula | C_5H_6 SMILES identifier | C=CC1=C(C)C=C(C)C=C1 InChI identifier | InChI=1/C10H12/c1-4-10-6-5-8(2)7-9(10)3/h4-7H, 1H2, 2-3H3 InChI key | OEVVKKAVYQFQNV-UHFFFAOYSA-N