Search

SMILES identifier of thallium(III) nitrate vs choline bicarbonate

Input interpretation

thallium(III) nitrate choline bicarbonate | SMILES identifier
thallium(III) nitrate choline bicarbonate | SMILES identifier

Results

thallium(III) nitrate | [N+](=O)([O-])[O-].[N+](=O)([O-])[O-].[N+](=O)([O-])[O-].[Tl+3] choline bicarbonate | C[N+](C)(C)CCO.C(=O)(O)[O-]
thallium(III) nitrate | [N+](=O)([O-])[O-].[N+](=O)([O-])[O-].[N+](=O)([O-])[O-].[Tl+3] choline bicarbonate | C[N+](C)(C)CCO.C(=O)(O)[O-]

Random Queries

boiling point of molybdenum trioxide
IUPAC ethylene dichloride
streak of anthoinite
alternate names of copper(I) oxide
name of ammonium chlorate
IUPAC thallous nitrate
freezing point of ethanol vs water
colors of platinum metals
atomic mass of americium
formula of sodium aluminate vs antimony(III) sulfate