2-bromopropionyl chloride

2-bromopropionyl chloride

formula | CH_3CHBrCOCl Hill formula | C_3H_4BrClO name | 2-bromopropionyl chloride IUPAC name | 2-bromopropanoyl chloride alternate names | 2-bromopropanoyl chloride | 2-bromopropionic acid chloride mass fractions | Br (bromine) 46.6% | C (carbon) 21% | Cl (chlorine) 20.7% | H (hydrogen) 2.35% | O (oxygen) 9.33%

Draw the Lewis structure of 2-bromopropionyl chloride. Start by drawing the overall structure of the molecule, ignoring potential double and triple bonds: Count the total valence electrons of the bromine (n_Br, val = 7), carbon (n_C, val = 4), chlorine (n_Cl, val = 7), hydrogen (n_H, val = 1), and oxygen (n_O, val = 6) atoms: n_Br, val + 3 n_C, val + n_Cl, val + 4 n_H, val + n_O, val = 36 Calculate the number of electrons needed to completely fill the valence shells for bromine (n_Br, full = 8), carbon (n_C, full = 8), chlorine (n_Cl, full = 8), hydrogen (n_H, full = 2), and oxygen (n_O, full = 8): n_Br, full + 3 n_C, full + n_Cl, full + 4 n_H, full + n_O, full = 56 Subtracting these two numbers shows that 56 - 36 = 20 bonding electrons are needed. Each bond has two electrons, so in addition to the 9 bonds already present in the diagram add 1 bond. To minimize formal charge oxygen wants 2 bonds and carbon wants 4 bonds. Identify the atoms that want additional bonds and the number of electrons remaining on each atom: Fill in the 1 bond by pairing electrons between adjacent highlighted atoms: Answer: | |

3D structure

molar mass | 171.42 g/mol phase | liquid (at STP) boiling point | 132 °C density | 1.7 g/cm^3 solubility in water | slightly soluble

density | 1.7 g/cm^3 refractive index | 1.477

CAS number | 7148-74-5 Beilstein number | 773800 PubChem CID number | 97980 PubChem SID number | 24848748 SMILES identifier | CC(C(=O)Cl)Br InChI identifier | InChI=1/C3H4BrClO/c1-2(4)3(5)6/h2H, 1H3 MDL number | MFCD00000711

flash point | 51.67 °C

DOT hazard class | 8 DOT numbers | 2920