cholesterol-2,2,3,4,4,6-d 6

cholesterol-2, 2, 3, 4, 4, 6-d 6

formula | C_27D_6H_39OH Hill formula | C_27H_40D_6O name | cholesterol-2, 2, 3, 4, 4, 6-d 6 IUPAC name | (3S, 8S, 9S, 10R, 13R, 14S, 17R)-2, 2, 3, 4, 4, 6-hexadeuterio-17-[(1R)-1, 5-dimethylhexyl]-10, 13-dimethyl-1, 7, 8, 9, 11, 12, 14, 15, 16, 17-decahydrocyclopenta[a]phenanthren-3-ol alternate names | (3S, 8S, 9S, 10R, 13R, 14S, 17R)-2, 2, 3, 4, 4, 6-hexadeuterio-10, 13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1, 7, 8, 9, 11, 12, 14, 15, 16, 17-decahydrocyclopenta[a]phenanthren-3-ol | (3S, 8S, 9S, 10R, 13R, 14S, 17R)-2, 2, 3, 4, 4, 6-hexadeuterio-17-[(1R)-1, 5-dimethylhexyl]-10, 13-dimethyl-1, 7, 8, 9, 11, 12, 14, 15, 16, 17-decahydrocyclopenta[a]phenanthren-3-ol mass fractions | O (oxygen) 0.0407% | C (carbon) 0.826% | H (hydrogen) 0.133%

Draw the Lewis structure of cholesterol-2, 2, 3, 4, 4, 6-d 6. Start by drawing the overall structure of the molecule, ignoring potential double and triple bonds: Count the total valence electrons of the carbon (n_C, val = 4), hydrogen (n_H, val = 1), and oxygen (n_O, val = 6) atoms: 27 n_C, val + 46 n_H, val + n_O, val = 160 Calculate the number of electrons needed to completely fill the valence shells for carbon (n_C, full = 8), hydrogen (n_H, full = 2), and oxygen (n_O, full = 8): 27 n_C, full + 46 n_H, full + n_O, full = 316 Subtracting these two numbers shows that 316 - 160 = 156 bonding electrons are needed. Each bond has two electrons, so in addition to the 77 bonds already present in the diagram add 1 bond. To minimize formal charge carbon wants 4 bonds. Identify the atoms that want additional bonds and the number of electrons remaining on each atom: Fill in the 1 bond by pairing electrons between adjacent highlighted atoms: Answer: | |

3D structure

molar mass | 392.7 g/mol phase | solid (at STP) melting point | 148 °C boiling point | 360 °C density | 1.088 g/cm^3

density | 1.088 g/cm^3

H-2 | 6

CAS number | 92543-08-3 PubChem CID number | 16213400 PubChem SID number | 24872407 SMILES identifier | CC(C)CCCC(C)C1CCC2C1(CCC3C2CC=C4C3(CCC(C4)O)C)C InChI identifier | InChI=1/C27H46O/c1-18(2)7-6-8-19(3)23-11-12-24-22-10-9-20-17-21(28)13-15-26(20, 4)25(22)14-16-27(23, 24)5/h9, 18-19, 21-25, 28H, 6-8, 10-17H2, 1-5H3/t19-, 21+, 22+, 23-, 24+, 25+, 26+, 27-/m1/s1/i9D, 13D2, 17D2, 21D MDL number | MFCD00209699