Search

DOT palladium

Input interpretation

sodium bromate | palladium
sodium bromate | palladium

Chemical names and formulas

| sodium bromate | palladium formula | NaBrO_3 | Pd Hill formula | BrNaO_3 | Pd name | sodium bromate | palladium IUPAC name | sodium bromate | palladium alternate names | DOT | dyetone | palladium metal mass fractions | Br (bromine) 53% | Na (sodium) 15.2% | O (oxygen) 31.8% | Pd (palladium) 100%
| sodium bromate | palladium formula | NaBrO_3 | Pd Hill formula | BrNaO_3 | Pd name | sodium bromate | palladium IUPAC name | sodium bromate | palladium alternate names | DOT | dyetone | palladium metal mass fractions | Br (bromine) 53% | Na (sodium) 15.2% | O (oxygen) 31.8% | Pd (palladium) 100%

Structure diagrams

Structure diagrams
Structure diagrams

Basic properties

| sodium bromate | palladium molar mass | 150.89 g/mol | 106.42 g/mol phase | solid (at STP) | solid (at STP) melting point | 381 °C | 1554 °C boiling point | 1390 °C | 2970 °C density | 3.339 g/cm^3 | 12.023 g/cm^3 solubility in water | soluble | insoluble
| sodium bromate | palladium molar mass | 150.89 g/mol | 106.42 g/mol phase | solid (at STP) | solid (at STP) melting point | 381 °C | 1554 °C boiling point | 1390 °C | 2970 °C density | 3.339 g/cm^3 | 12.023 g/cm^3 solubility in water | soluble | insoluble

Units

Thermodynamic properties

| sodium bromate | palladium molar heat of vaporization | | 380 kJ/mol (kilojoules per mole) specific heat of vaporization | | 3.57 kJ/g (kilojoules per gram) molar heat of fusion | 28.11 kJ/mol (kilojoules per mole) | 16.74 kJ/mol (kilojoules per mole) specific heat of fusion | 0.1863 kJ/g (kilojoules per gram) | 0.1573 kJ/g (kilojoules per gram)
| sodium bromate | palladium molar heat of vaporization | | 380 kJ/mol (kilojoules per mole) specific heat of vaporization | | 3.57 kJ/g (kilojoules per gram) molar heat of fusion | 28.11 kJ/mol (kilojoules per mole) | 16.74 kJ/mol (kilojoules per mole) specific heat of fusion | 0.1863 kJ/g (kilojoules per gram) | 0.1573 kJ/g (kilojoules per gram)

Solid properties (at STP)

| sodium bromate | palladium density | 3.339 g/cm^3 | 12.023 g/cm^3 vapor pressure | | 0.1 mmHg
| sodium bromate | palladium density | 3.339 g/cm^3 | 12.023 g/cm^3 vapor pressure | | 0.1 mmHg

Units

Chemical identifiers

| sodium bromate | palladium CAS number | 7789-38-0 | 7440-05-3 PubChem CID number | 23668195 | 23938 PubChem SID number | 24853461 | 24852078 SMILES identifier | [O-]Br(=O)=O.[Na+] | [Pd] InChI identifier | InChI=1/BrHO3.Na/c2-1(3)4;/h(H, 2, 3, 4);/q;+1/p-1/fBrO3.Na/q-1;m | InChI=1/Pd RTECS number | EF8750000 | RT3480500 MDL number | MFCD00003476 | MFCD00011167
| sodium bromate | palladium CAS number | 7789-38-0 | 7440-05-3 PubChem CID number | 23668195 | 23938 PubChem SID number | 24853461 | 24852078 SMILES identifier | [O-]Br(=O)=O.[Na+] | [Pd] InChI identifier | InChI=1/BrHO3.Na/c2-1(3)4;/h(H, 2, 3, 4);/q;+1/p-1/fBrO3.Na/q-1;m | InChI=1/Pd RTECS number | EF8750000 | RT3480500 MDL number | MFCD00003476 | MFCD00011167

NFPA label

NFPA label
NFPA label
| sodium bromate | palladium NFPA health rating | | 1 NFPA fire rating | | 0 NFPA reactivity rating | | 0 NFPA hazards | oxidizing agent |
| sodium bromate | palladium NFPA health rating | | 1 NFPA fire rating | | 0 NFPA reactivity rating | | 0 NFPA hazards | oxidizing agent |

Random Queries

CAS number of sym-tetrachloroethane
chemical types of vanadium(IV) oxide sulfate hydrate vs manganese(II) fluoride
formula of cyclopentane vs 3-methylcyclohexene
alternate names of niobium(IV) telluride
chemical uses of fotemustine
chemical types silver(I) acetylide
formula of gramicidin d
density of lead(II) chromate
NFPA reactivity rating of cumene vs alpha,alpha-dimethoxytoluene
formula of heptadecanoyl chloride vs 3-methyl-1-butylboronic acid