Input interpretation
pearl ash | sodium acetate
Chemical names and formulas
| pearl ash | sodium acetate formula | K_2CO_3 | CH_3COONa Hill formula | CK_2O_3 | C_2H_3NaO_2 name | pearl ash | sodium acetate IUPAC name | dipotassium carbonate | sodium acetate alternate names | dipotassium carbonate | potash | potassium carbonate | salt of tartar | acetic acid, sodium salt | acetic acid sodium salt | anhydrous sodium acetate | sodium acetate, anhydrous | sodium acetate anhydrous | sodium ethanoate mass fractions | C (carbon) 8.69% | K (potassium) 56.6% | O (oxygen) 34.7% | C (carbon) 29.3% | H (hydrogen) 3.69% | Na (sodium) 28% | O (oxygen) 39%
Structure diagrams
| pearl ash | sodium acetate vertex count | 6 | 5 edge count | 3 | 3 Schultz index | 36 | 36 Wiener index | 9 | 9 Hosoya index | 4 | 4 Balaban index | 2.324 | 2.324
Basic properties
| pearl ash | sodium acetate molar mass | 138.2 g/mol | 82.034 g/mol phase | solid (at STP) | solid (at STP) melting point | 891 °C | 300 °C boiling point | | 881.4 °C density | 2.43 g/cm^3 | 1.528 g/cm^3 solubility in water | soluble | soluble
Units
Thermodynamic properties
| pearl ash | sodium acetate molar heat of fusion | 27.6 kJ/mol (kilojoules per mole) | 17.9 kJ/mol (kilojoules per mole) specific heat of fusion | 0.2 kJ/g (kilojoules per gram) | 0.2182 kJ/g (kilojoules per gram)
Solid properties (at STP)
| pearl ash | sodium acetate density | 2.43 g/cm^3 | 1.528 g/cm^3 refractive index | | 1.464
Units
Chemical identifiers
![| pearl ash | sodium acetate CAS number | 584-08-7 | 127-09-3 Beilstein number | 4267587 | 3595639 PubChem CID number | 516886 | 517045 PubChem SID number | 24862856 | 24853755 SMILES identifier | C(=O)([O-])[O-].[K+].[K+] | CC(=O)[O-].[Na+] InChI identifier | InChI=1/CH2O3.2K/c2-1(3)4;;/h(H2, 2, 3, 4);;/q;2*+1/p-2/fCO3.2K/q-2;2m | InChI=1/C2H4O2.Na/c1-2(3)4;/h1H3, (H, 3, 4);/q;+1/p-1/fC2H3O2.Na/q-1;m RTECS number | TS7750000 | AJ4300010 MDL number | MFCD00011382 | MFCD00012459](../image_source/36e6b786e8841f519283b4173edabae4.png)
| pearl ash | sodium acetate CAS number | 584-08-7 | 127-09-3 Beilstein number | 4267587 | 3595639 PubChem CID number | 516886 | 517045 PubChem SID number | 24862856 | 24853755 SMILES identifier | C(=O)([O-])[O-].[K+].[K+] | CC(=O)[O-].[Na+] InChI identifier | InChI=1/CH2O3.2K/c2-1(3)4;;/h(H2, 2, 3, 4);;/q;2*+1/p-2/fCO3.2K/q-2;2m | InChI=1/C2H4O2.Na/c1-2(3)4;/h1H3, (H, 3, 4);/q;+1/p-1/fC2H3O2.Na/q-1;m RTECS number | TS7750000 | AJ4300010 MDL number | MFCD00011382 | MFCD00012459
NFPA label
NFPA label
| pearl ash | sodium acetate NFPA health rating | 1 | 1 NFPA fire rating | 0 | 1 NFPA reactivity rating | 0 | 0