Search

name of cadmiu oxalate

Input interpretation

cadmiu oxalate
cadmiu oxalate

Chemical names and formulas

formula | CdC_2O_4 Hill formula | C_2CdO_4 name | cadmiu oxalate IUPAC name | cadmium(+2) cation; oxalate alternate names | cadmium(+2) cation; ethanedioate | cadmium(+2) cation; oxalate mass fractions | C (carbon) 12% | Cd (cadmium) 56.1% | O (oxygen) 31.9%
formula | CdC_2O_4 Hill formula | C_2CdO_4 name | cadmiu oxalate IUPAC name | cadmium(+2) cation; oxalate alternate names | cadmium(+2) cation; ethanedioate | cadmium(+2) cation; oxalate mass fractions | C (carbon) 12% | Cd (cadmium) 56.1% | O (oxygen) 31.9%

Structure diagram

Structure diagram
Structure diagram
vertex count | 7 edge count | 5 Schultz index | 108 Wiener index | 29 Hosoya index | 10 Balaban index | 2.993
vertex count | 7 edge count | 5 Schultz index | 108 Wiener index | 29 Hosoya index | 10 Balaban index | 2.993

Basic properties

molar mass | 200.43 g/mol
molar mass | 200.43 g/mol

Units

Chemical identifiers

PubChem CID number | 15607650 SMILES identifier | C(=O)(C(=O)[O-])[O-].[Cd+2] InChI identifier | InChI=1/C2H2O4.Cd/c3-1(4)2(5)6;/h(H, 3, 4)(H, 5, 6);/q;+2/p-2/fC2O4.Cd/q-2;m
PubChem CID number | 15607650 SMILES identifier | C(=O)(C(=O)[O-])[O-].[Cd+2] InChI identifier | InChI=1/C2H2O4.Cd/c3-1(4)2(5)6;/h(H, 3, 4)(H, 5, 6);/q;+2/p-2/fC2O4.Cd/q-2;m

Random Queries

atomic radius of ytterbium vs praseodymium
critical pressure of Lewis acids
discovery year of hydrogen vs thallium
molar mass of tetrabromophenolphthalein ethyl ester
phase at STP of group 4 elements
density of ferrous oxalate vs (trimethylsilyl)methyllithium
molar mass of arsenic trioxide
discovery year of vanadium CAS
total number of electrons of group 2 ions
vertex types of hydrogen bromide