Search

SMILES identifier of 4-iodophenol vs 2,3-difluoro-6-nitrophenol

Input interpretation

4-iodophenol 2, 3-difluoro-6-nitrophenol | SMILES identifier
4-iodophenol 2, 3-difluoro-6-nitrophenol | SMILES identifier

Results

4-iodophenol | C1=CC(=CC=C1O)I 2, 3-difluoro-6-nitrophenol | C1=CC(=C(C(=C1F)F)O)[N+](=O)[O-]
4-iodophenol | C1=CC(=CC=C1O)I 2, 3-difluoro-6-nitrophenol | C1=CC(=C(C(=C1F)F)O)[N+](=O)[O-]

Random Queries

IUPAC name of 4-bromo-2-fluorophenylzinc iodide
Al + Si = AlSi
formula of potassium permanganate vs germanium(II) selenide
lethal dosage of polar aprotic solvents
H2SO4 + KI + NaClO = H2O + K2SO4 + I2 + NaCl
formula of osmium vs selenium dioxide
molar mass of chromium(II) cation vs scandium(III) cation
chemical types of hypoiodous acid vs trimethylamine
H2SO4 + NaI = H2O + I2 + H2S + Na2SO4
chemical types of calcium vs aluminum chloride