Input interpretation
![dimethyl heptenal](../image_source/914563e1d8365f3c8028c6f03d1b7362.png)
dimethyl heptenal
Basic properties
![molar mass | 140.2 g/mol formula | C_9H_16O empirical formula | C_9O_H_16 SMILES identifier | CCCCC(=C(C)C=O)C InChI identifier | InChI=1/C9H16O/c1-4-5-6-8(2)9(3)7-10/h7H, 4-6H2, 1-3H3 InChI key | CJKWGCWVBLTMBA-UHFFFAOYSA-N](../image_source/c3e4f464c3558619cac63dcb0ce3de04.png)
molar mass | 140.2 g/mol formula | C_9H_16O empirical formula | C_9O_H_16 SMILES identifier | CCCCC(=C(C)C=O)C InChI identifier | InChI=1/C9H16O/c1-4-5-6-8(2)9(3)7-10/h7H, 4-6H2, 1-3H3 InChI key | CJKWGCWVBLTMBA-UHFFFAOYSA-N
Lewis structure
![Draw the Lewis structure of dimethyl heptenal. Start by drawing the overall structure of the molecule, ignoring potential double and triple bonds: Count the total valence electrons of the carbon (n_C, val = 4), hydrogen (n_H, val = 1), and oxygen (n_O, val = 6) atoms: 9 n_C, val + 16 n_H, val + n_O, val = 58 Calculate the number of electrons needed to completely fill the valence shells for carbon (n_C, full = 8), hydrogen (n_H, full = 2), and oxygen (n_O, full = 8): 9 n_C, full + 16 n_H, full + n_O, full = 112 Subtracting these two numbers shows that 112 - 58 = 54 bonding electrons are needed. Each bond has two electrons, so in addition to the 25 bonds already present in the diagram add 2 bonds. To minimize formal charge carbon wants 4 bonds and oxygen wants 2 bonds. Identify the atoms that want additional bonds and the number of electrons remaining on each atom: Fill in the 2 bonds by pairing electrons between adjacent highlighted atoms: Answer: | |](../image_source/ce68abd4586f3e574721db832e1fe11b.png)
Draw the Lewis structure of dimethyl heptenal. Start by drawing the overall structure of the molecule, ignoring potential double and triple bonds: Count the total valence electrons of the carbon (n_C, val = 4), hydrogen (n_H, val = 1), and oxygen (n_O, val = 6) atoms: 9 n_C, val + 16 n_H, val + n_O, val = 58 Calculate the number of electrons needed to completely fill the valence shells for carbon (n_C, full = 8), hydrogen (n_H, full = 2), and oxygen (n_O, full = 8): 9 n_C, full + 16 n_H, full + n_O, full = 112 Subtracting these two numbers shows that 112 - 58 = 54 bonding electrons are needed. Each bond has two electrons, so in addition to the 25 bonds already present in the diagram add 2 bonds. To minimize formal charge carbon wants 4 bonds and oxygen wants 2 bonds. Identify the atoms that want additional bonds and the number of electrons remaining on each atom: Fill in the 2 bonds by pairing electrons between adjacent highlighted atoms: Answer: | |
Estimated thermodynamic properties
![melting point | -72.96 °C boiling point | 184.7 °C critical temperature | 642.2 K critical pressure | 2.641 MPa critical volume | 538.5 cm^3/mol molar heat of vaporization | 42.5 kJ/mol molar heat of fusion | 18.94 kJ/mol molar enthalpy | -217 kJ/mol molar free energy | -11.5 kJ/mol (computed using the Joback method)](../image_source/d6cef8b3d72faf287a512471ec7377ab.png)
melting point | -72.96 °C boiling point | 184.7 °C critical temperature | 642.2 K critical pressure | 2.641 MPa critical volume | 538.5 cm^3/mol molar heat of vaporization | 42.5 kJ/mol molar heat of fusion | 18.94 kJ/mol molar enthalpy | -217 kJ/mol molar free energy | -11.5 kJ/mol (computed using the Joback method)
Units
Quantitative molecular descriptors
![longest chain length | 8 atoms longest straight chain length | 8 atoms longest aliphatic chain length | 7 atoms aromatic atom count | 0 atoms H-bond acceptor count | 1 atom H-bond donor count | 0 atoms](../image_source/f0e952a53f26bea1d8a3f510e356baac.png)
longest chain length | 8 atoms longest straight chain length | 8 atoms longest aliphatic chain length | 7 atoms aromatic atom count | 0 atoms H-bond acceptor count | 1 atom H-bond donor count | 0 atoms
Elemental composition
![Find the elemental composition for dimethyl heptenal in terms of the atom and mass percents: atom percent = N_i/N_atoms × 100% mass percent = (N_im_i)/m × 100% Plan: • Write the chemical formula and gather atomic masses from the periodic table. • Determine values for N_i, m_i, N_atoms and m using these items. • Finally, compute the percents and check the results. Write the chemical formula: C_9H_16O Use the chemical formula to count the number of atoms, N_i, for each element and find the total number of atoms, N_atoms, per molecule: | number of atoms C (carbon) | 9 O (oxygen) | 1 H (hydrogen) | 16 N_atoms = 9 + 1 + 16 = 26 Divide each N_i by N_atoms to calculate atom fractions. Then use the property that atom fractions must sum to one to check the work: | number of atoms | atom fraction C (carbon) | 9 | 9/26 O (oxygen) | 1 | 1/26 H (hydrogen) | 16 | 16/26 Check: 9/26 + 1/26 + 16/26 = 1 Compute atom percents using the atom fractions: | number of atoms | atom percent C (carbon) | 9 | 9/26 × 100% = 34.6% O (oxygen) | 1 | 1/26 × 100% = 3.85% H (hydrogen) | 16 | 16/26 × 100% = 61.5% Look up the atomic mass, m_i, in unified atomic mass units, u, for each element in the periodic table: | number of atoms | atom percent | atomic mass/u C (carbon) | 9 | 34.6% | 12.011 O (oxygen) | 1 | 3.85% | 15.999 H (hydrogen) | 16 | 61.5% | 1.008 Multiply N_i by m_i to compute the mass for each element. Then sum those values to compute the molecular mass, m: | number of atoms | atom percent | atomic mass/u | mass/u C (carbon) | 9 | 34.6% | 12.011 | 9 × 12.011 = 108.099 O (oxygen) | 1 | 3.85% | 15.999 | 1 × 15.999 = 15.999 H (hydrogen) | 16 | 61.5% | 1.008 | 16 × 1.008 = 16.128 m = 108.099 u + 15.999 u + 16.128 u = 140.226 u Divide the mass for each element by m to calculate mass fractions. Then use the property that mass fractions must sum to one to check the work: | number of atoms | atom percent | mass fraction C (carbon) | 9 | 34.6% | 108.099/140.226 O (oxygen) | 1 | 3.85% | 15.999/140.226 H (hydrogen) | 16 | 61.5% | 16.128/140.226 Check: 108.099/140.226 + 15.999/140.226 + 16.128/140.226 = 1 Compute mass percents using the mass fractions: Answer: | | | number of atoms | atom percent | mass percent C (carbon) | 9 | 34.6% | 108.099/140.226 × 100% = 77.09% O (oxygen) | 1 | 3.85% | 15.999/140.226 × 100% = 11.41% H (hydrogen) | 16 | 61.5% | 16.128/140.226 × 100% = 11.50%](../image_source/2a028425fe4c7be9b96429959c354bce.png)
Find the elemental composition for dimethyl heptenal in terms of the atom and mass percents: atom percent = N_i/N_atoms × 100% mass percent = (N_im_i)/m × 100% Plan: • Write the chemical formula and gather atomic masses from the periodic table. • Determine values for N_i, m_i, N_atoms and m using these items. • Finally, compute the percents and check the results. Write the chemical formula: C_9H_16O Use the chemical formula to count the number of atoms, N_i, for each element and find the total number of atoms, N_atoms, per molecule: | number of atoms C (carbon) | 9 O (oxygen) | 1 H (hydrogen) | 16 N_atoms = 9 + 1 + 16 = 26 Divide each N_i by N_atoms to calculate atom fractions. Then use the property that atom fractions must sum to one to check the work: | number of atoms | atom fraction C (carbon) | 9 | 9/26 O (oxygen) | 1 | 1/26 H (hydrogen) | 16 | 16/26 Check: 9/26 + 1/26 + 16/26 = 1 Compute atom percents using the atom fractions: | number of atoms | atom percent C (carbon) | 9 | 9/26 × 100% = 34.6% O (oxygen) | 1 | 1/26 × 100% = 3.85% H (hydrogen) | 16 | 16/26 × 100% = 61.5% Look up the atomic mass, m_i, in unified atomic mass units, u, for each element in the periodic table: | number of atoms | atom percent | atomic mass/u C (carbon) | 9 | 34.6% | 12.011 O (oxygen) | 1 | 3.85% | 15.999 H (hydrogen) | 16 | 61.5% | 1.008 Multiply N_i by m_i to compute the mass for each element. Then sum those values to compute the molecular mass, m: | number of atoms | atom percent | atomic mass/u | mass/u C (carbon) | 9 | 34.6% | 12.011 | 9 × 12.011 = 108.099 O (oxygen) | 1 | 3.85% | 15.999 | 1 × 15.999 = 15.999 H (hydrogen) | 16 | 61.5% | 1.008 | 16 × 1.008 = 16.128 m = 108.099 u + 15.999 u + 16.128 u = 140.226 u Divide the mass for each element by m to calculate mass fractions. Then use the property that mass fractions must sum to one to check the work: | number of atoms | atom percent | mass fraction C (carbon) | 9 | 34.6% | 108.099/140.226 O (oxygen) | 1 | 3.85% | 15.999/140.226 H (hydrogen) | 16 | 61.5% | 16.128/140.226 Check: 108.099/140.226 + 15.999/140.226 + 16.128/140.226 = 1 Compute mass percents using the mass fractions: Answer: | | | number of atoms | atom percent | mass percent C (carbon) | 9 | 34.6% | 108.099/140.226 × 100% = 77.09% O (oxygen) | 1 | 3.85% | 15.999/140.226 × 100% = 11.41% H (hydrogen) | 16 | 61.5% | 16.128/140.226 × 100% = 11.50%
Elemental oxidation states
![The first step in finding the oxidation states (or oxidation numbers) in dimethyl heptenal is to draw the structure diagram. Next set every oxidation number equal to the atom's formal charge: In dimethyl heptenal hydrogen is not bonded to a metal with lower electronegativity, so it will have an oxidation state of +1. Any element bonded to hydrogen gains the bonding electrons, decreasing their oxidation state by 1 for every bond: With hydrogen out of the way, look at the remaining bonds. There are 1 carbon-oxygen bond, and 8 carbon-carbon bonds. For each of these bonds, assign the bonding electrons to the most electronegative element. First examine the carbon-oxygen bond: element | electronegativity (Pauling scale) | C | 2.55 | O | 3.44 | | | Since oxygen is more electronegative than carbon, the electrons in this bond will go to oxygen. Decrease the oxidation number for oxygen (by 1 for single bonds, 2 for double bonds, and 3 for triple bonds), and increase the oxidation number for carbon accordingly: Next look at the carbon-carbon bonds: element | electronegativity (Pauling scale) | C | 2.55 | C | 2.55 | | | Since these elements are the same the bonding electrons are shared equally, and there is no change to the oxidation states: Now summarize the results: Answer: | | oxidation state | element | count -3 | C (carbon) | 3 -2 | C (carbon) | 3 | O (oxygen) | 1 0 | C (carbon) | 2 +1 | C (carbon) | 1 | H (hydrogen) | 16](../image_source/e67fbb25224cd59cba46ed26cac13cce.png)
The first step in finding the oxidation states (or oxidation numbers) in dimethyl heptenal is to draw the structure diagram. Next set every oxidation number equal to the atom's formal charge: In dimethyl heptenal hydrogen is not bonded to a metal with lower electronegativity, so it will have an oxidation state of +1. Any element bonded to hydrogen gains the bonding electrons, decreasing their oxidation state by 1 for every bond: With hydrogen out of the way, look at the remaining bonds. There are 1 carbon-oxygen bond, and 8 carbon-carbon bonds. For each of these bonds, assign the bonding electrons to the most electronegative element. First examine the carbon-oxygen bond: element | electronegativity (Pauling scale) | C | 2.55 | O | 3.44 | | | Since oxygen is more electronegative than carbon, the electrons in this bond will go to oxygen. Decrease the oxidation number for oxygen (by 1 for single bonds, 2 for double bonds, and 3 for triple bonds), and increase the oxidation number for carbon accordingly: Next look at the carbon-carbon bonds: element | electronegativity (Pauling scale) | C | 2.55 | C | 2.55 | | | Since these elements are the same the bonding electrons are shared equally, and there is no change to the oxidation states: Now summarize the results: Answer: | | oxidation state | element | count -3 | C (carbon) | 3 -2 | C (carbon) | 3 | O (oxygen) | 1 0 | C (carbon) | 2 +1 | C (carbon) | 1 | H (hydrogen) | 16
Orbital hybridization
![First draw the structure diagram for dimethyl heptenal, and for every non-hydrogen atom, count the σ-bonds. Note that double and triple bonds consist of one σ-bond together with one or two π-bonds: Identify those atoms with lone pairs: Find the steric number by adding the lone pair count to the number of σ-bonds: Consult the following chart to determine the hybridization from the steric number: steric number | hybridization 2 | sp 3 | sp^2 4 | sp^3 5 | dsp^3 6 | d^2sp^3 7 | d^3sp^3 Now assign the hybridization for each atom: Answer: | |](../image_source/23c92867f6cc5ddcd1aed9e755df2d18.png)
First draw the structure diagram for dimethyl heptenal, and for every non-hydrogen atom, count the σ-bonds. Note that double and triple bonds consist of one σ-bond together with one or two π-bonds: Identify those atoms with lone pairs: Find the steric number by adding the lone pair count to the number of σ-bonds: Consult the following chart to determine the hybridization from the steric number: steric number | hybridization 2 | sp 3 | sp^2 4 | sp^3 5 | dsp^3 6 | d^2sp^3 7 | d^3sp^3 Now assign the hybridization for each atom: Answer: | |
Topological indices
![vertex count | 26 edge count | 25 Schultz index | 4946 Wiener index | 1364 Hosoya index | 23574 Balaban index | 6.702](../image_source/849f9ad9f4b1a569fd1ba2e631980cb6.png)
vertex count | 26 edge count | 25 Schultz index | 4946 Wiener index | 1364 Hosoya index | 23574 Balaban index | 6.702