Search

InChI identifier of cadmium carbonate

Input interpretation

cadmium carbonate | InChI identifier
cadmium carbonate | InChI identifier

Result

InChI=1/CH2O3.Cd/c2-1(3)4;/h(H2, 2, 3, 4);/q;+2/p-2/fCO3.Cd/q-2;m
InChI=1/CH2O3.Cd/c2-1(3)4;/h(H2, 2, 3, 4);/q;+2/p-2/fCO3.Cd/q-2;m

Random Queries

CAS number of carbon vs phosphorus
chemical types of magnesium nitride
chemical types of strontium hydride
phases of organic solvents
2CrO4 + Ag
molar mass of tributyltin benzoate
edge types of 1,1'-(4-chlorobutylidene)bis(4-fluorobenzene)
freezing point of 3-(trifluoromethoxy)benzonitrile vs isovaleronitrile
Cl2 + NaOH + Na3P = H2O + NaCl + Na3PO4
HCl + Zn + H2PO3 = H2O + ZnCl2 + PH3