Input interpretation
![phenoxybenzamine hydrochloride | styrene oxide](../image_source/365a476c3f32c1b9bbdd8997df163380.png)
phenoxybenzamine hydrochloride | styrene oxide
Chemical names and formulas
![| phenoxybenzamine hydrochloride | styrene oxide formula | C_18H_23Cl_2NO | C_8H_8O Hill formula | C_18H_23Cl_2NO | C_8H_8O name | phenoxybenzamine hydrochloride | styrene oxide IUPAC name | benzyl-(2-chloroethyl)-(1-phenoxypropan-2-yl)azanium chloride | 2-phenyloxirane alternate names | dibenzyline hydrochloride | 1, 2-epoxyethylbenzene | 2-phenyloxirane | epoxystyrene | phenylethylene oxide | phenyloxirane | styrene epoxide | styryl oxide mass fractions | C (carbon) 63.5% | Cl (chlorine) 20.8% | H (hydrogen) 6.81% | N (nitrogen) 4.12% | O (oxygen) 4.7% | C (carbon) 80% | H (hydrogen) 6.71% | O (oxygen) 13.3%](../image_source/e3a9dc8842800d1404fa59fc0535be79.png)
| phenoxybenzamine hydrochloride | styrene oxide formula | C_18H_23Cl_2NO | C_8H_8O Hill formula | C_18H_23Cl_2NO | C_8H_8O name | phenoxybenzamine hydrochloride | styrene oxide IUPAC name | benzyl-(2-chloroethyl)-(1-phenoxypropan-2-yl)azanium chloride | 2-phenyloxirane alternate names | dibenzyline hydrochloride | 1, 2-epoxyethylbenzene | 2-phenyloxirane | epoxystyrene | phenylethylene oxide | phenyloxirane | styrene epoxide | styryl oxide mass fractions | C (carbon) 63.5% | Cl (chlorine) 20.8% | H (hydrogen) 6.81% | N (nitrogen) 4.12% | O (oxygen) 4.7% | C (carbon) 80% | H (hydrogen) 6.71% | O (oxygen) 13.3%
Structure diagrams
![| phenoxybenzamine hydrochloride | styrene oxide vertex count | 22 | 9 edge count | 23 | 10 Schultz index | 4388 | 425 Wiener index | 1046 | 87 Hosoya index | 24408 | 88 Balaban index | 1.722 | 1.803](../image_source/539662bfb5027373bae42d61b4d38490.png)
| phenoxybenzamine hydrochloride | styrene oxide vertex count | 22 | 9 edge count | 23 | 10 Schultz index | 4388 | 425 Wiener index | 1046 | 87 Hosoya index | 24408 | 88 Balaban index | 1.722 | 1.803
3D structure
![3D structure](../image_source/2501a635c19fc8a4b58180cb72010b02.png)
3D structure
Basic properties
![| phenoxybenzamine hydrochloride | styrene oxide molar mass | 340.3 g/mol | 120.15 g/mol phase | solid (at STP) | liquid (at STP) melting point | 138.8 °C | -37 °C boiling point | | 194 °C density | | 1.054 g/cm^3 solubility in water | | slightly soluble](../image_source/628b181924e45b828e0d66ce8fe1ff2f.png)
| phenoxybenzamine hydrochloride | styrene oxide molar mass | 340.3 g/mol | 120.15 g/mol phase | solid (at STP) | liquid (at STP) melting point | 138.8 °C | -37 °C boiling point | | 194 °C density | | 1.054 g/cm^3 solubility in water | | slightly soluble
Units
Hydrophobicity and permeability properties
![| phenoxybenzamine hydrochloride experimental LogP hydrophobicity | 4.7 predicted LogP hydrophobicity | 4.26 predicted LogS | -4.47](../image_source/9c63577a4574ae16535cc73840da8b6f.png)
| phenoxybenzamine hydrochloride experimental LogP hydrophobicity | 4.7 predicted LogP hydrophobicity | 4.26 predicted LogS | -4.47
Liquid properties
![| styrene oxide density | 1.054 g/cm^3 vapor pressure | 0.9998 mmHg dynamic viscosity | 0.00199 Pa s refractive index | 1.535](../image_source/a5a0f49c894535cef18213d5db24e713.png)
| styrene oxide density | 1.054 g/cm^3 vapor pressure | 0.9998 mmHg dynamic viscosity | 0.00199 Pa s refractive index | 1.535
Units
Chemical identifiers
![| phenoxybenzamine hydrochloride | styrene oxide CAS number | 63-92-3 | 96-09-3 Beilstein number | 3747029 | 108582 PubChem CID number | 6141 | 7276 PubChem SID number | 9639 | 24899628 SMILES identifier | CC(COC1=CC=CC=C1)[NH+](CCCl)CC2=CC=CC=C2.[Cl-] | C1C(O1)C2=CC=CC=C2](../image_source/a548bb09200e64a4a91cc28176050577.png)
| phenoxybenzamine hydrochloride | styrene oxide CAS number | 63-92-3 | 96-09-3 Beilstein number | 3747029 | 108582 PubChem CID number | 6141 | 7276 PubChem SID number | 9639 | 24899628 SMILES identifier | CC(COC1=CC=CC=C1)[NH+](CCCl)CC2=CC=CC=C2.[Cl-] | C1C(O1)C2=CC=CC=C2