Search

InChI identifier of tris[trinitratocerium(IV)]paraperiodate vs 1-iodo-4-nitrobenzene

Input interpretation

tris[trinitratocerium(IV)]paraperiodate 1-iodo-4-nitrobenzene | InChI identifier
tris[trinitratocerium(IV)]paraperiodate 1-iodo-4-nitrobenzene | InChI identifier

Results

tris[trinitratocerium(IV)]paraperiodate | InChI=1/3Ce.H5IO6.9NO3/c;;;2-1(3, 4, 5, 6)7;9*2-1(3)4/h;;;(H5, 2, 3, 4, 5, 6, 7);;;;;;;;;/q3*+4;;9*-1/p-3/f3Ce.H2IO6.9NO3/h;;;2-3H;;;;;;;;;/q3m;-3;9m 1-iodo-4-nitrobenzene | InChI=1/C6H4INO2/c7-5-1-3-6(4-2-5)8(9)10/h1-4H
tris[trinitratocerium(IV)]paraperiodate | InChI=1/3Ce.H5IO6.9NO3/c;;;2-1(3, 4, 5, 6)7;9*2-1(3)4/h;;;(H5, 2, 3, 4, 5, 6, 7);;;;;;;;;/q3*+4;;9*-1/p-3/f3Ce.H2IO6.9NO3/h;;;2-3H;;;;;;;;;/q3m;-3;9m 1-iodo-4-nitrobenzene | InChI=1/C6H4INO2/c7-5-1-3-6(4-2-5)8(9)10/h1-4H

Random Queries

formula of copper(II) vanadate
HCl + KI + KBrO3 = H2O + I2 + KCl + KBr
how much is an ounce of marijuana
formula of manganese(V) cation vs copper(II) cation
IUPAC name of nitrogen trioxide
name of krypton(II) cation
alternate names of calcium chloride
CAS number of sodium hexafluorophosphate
decomposition point of palladium(II) iodide
alternate names of ferride(1-) anion