Input interpretation
lead(II) oxalate
Chemical names and formulas
formula | PbC_2O_4 Hill formula | C_2O_4Pb name | lead(II) oxalate IUPAC name | lead(+2) cation; oxalate alternate names | ethanedioic acid, lead(2+) salt (1:1) | lead oxalate mass fractions | C (carbon) 8.14% | O (oxygen) 21.7% | Pb (lead) 70.2%
Structure diagram
Structure diagram
vertex count | 7 edge count | 5 Schultz index | 108 Wiener index | 29 Hosoya index | 10 Balaban index | 2.993
Basic properties
molar mass | 295.2 g/mol density | 5.28 g/cm^3
Units
Thermodynamic properties
specific heat capacity c_p | solid | 0.357 J/(g K) molar heat capacity c_p | solid | 105.4 J/(mol K) specific free energy of formation Δ_fG° | solid | -2.541 kJ/g molar free energy of formation Δ_fG° | solid | -750.1 kJ/mol specific heat of formation Δ_fH° | solid | -2.884 kJ/g molar heat of formation Δ_fH° | solid | -851.4 kJ/mol (at STP)
Chemical identifiers
![CAS number | 814-93-7 Beilstein number | 3708425 PubChem CID number | 61218 SMILES identifier | C(=O)(C(=O)[O-])[O-].[Pb+2] InChI identifier | InChI=1/C2H2O4.Pb/c3-1(4)2(5)6;/h(H, 3, 4)(H, 5, 6);/q;+2/p-2/fC2O4.Pb/q-2;m EU number | 212-413-5](../image_source/dcc30e10846ae3c5c7eb94dfca8870f1.png)
CAS number | 814-93-7 Beilstein number | 3708425 PubChem CID number | 61218 SMILES identifier | C(=O)(C(=O)[O-])[O-].[Pb+2] InChI identifier | InChI=1/C2H2O4.Pb/c3-1(4)2(5)6;/h(H, 3, 4)(H, 5, 6);/q;+2/p-2/fC2O4.Pb/q-2;m EU number | 212-413-5
Ion equivalents
Pb^(2+) (lead(II) cation) | 1 (C_2O_4)^(2-) (oxalate anion) | 1