Input interpretation
5-fluoro-2-propoxyphenylboronic acid
Chemical names and formulas
formula | C_9H_12BFO_3 name | 5-fluoro-2-propoxyphenylboronic acid IUPAC name | (5-fluoro-2-propoxyphenyl)boronic acid alternate names | (5-fluoro-2-propoxy-phenyl)boronic acid | (5-fluoro-2-propoxyphenyl)boronic acid mass fractions | B (boron) 5.46% | C (carbon) 54.6% | F (fluorine) 9.6% | H (hydrogen) 6.11% | O (oxygen) 24.2%
Lewis structure
Draw the Lewis structure of 5-fluoro-2-propoxyphenylboronic acid. Start by drawing the overall structure of the molecule, ignoring potential double and triple bonds: Count the total valence electrons of the boron (n_B, val = 3), carbon (n_C, val = 4), fluorine (n_F, val = 7), hydrogen (n_H, val = 1), and oxygen (n_O, val = 6) atoms: n_B, val + 9 n_C, val + n_F, val + 12 n_H, val + 3 n_O, val = 76 Calculate the number of electrons needed to completely fill the valence shells for boron (n_B, full = 6), carbon (n_C, full = 8), fluorine (n_F, full = 8), hydrogen (n_H, full = 2), and oxygen (n_O, full = 8): n_B, full + 9 n_C, full + n_F, full + 12 n_H, full + 3 n_O, full = 134 Subtracting these two numbers shows that 134 - 76 = 58 bonding electrons are needed. Each bond has two electrons, so in addition to the 26 bonds already present in the diagram add 3 bonds. To minimize formal charge carbon wants 4 bonds. Identify the atoms that want additional bonds and the number of electrons remaining on each atom: Fill in the 3 bonds by pairing electrons between adjacent highlighted atoms. Note that the six atom ring is aromatic, so that the single and double bonds may be rearranged: Answer: | |
Basic properties
molar mass | 198 g/mol phase | solid (at STP) melting point | 88.5 °C
Units
Chemical identifiers
CAS number | 480438-73-1 PubChem CID number | 16217217 PubChem SID number | 24880255 SMILES identifier | B(C1=C(C=CC(=C1)F)OCCC)(O)O InChI identifier | InChI=1/C9H12BFO3/c1-2-5-14-9-4-3-7(11)6-8(9)10(12)13/h3-4, 6, 12-13H, 2, 5H2, 1H3 MDL number | MFCD05664233