Search

nickel(II) fluoborate

Input interpretation

nickel(II) fluoborate
nickel(II) fluoborate

Chemical names and formulas

formula | Ni(BF_4)_2 Hill formula | B_2F_8Ni name | nickel(II) fluoborate IUPAC name | nickelous ditetrafluoroborate alternate names | borate(1-), tetrafluoro-, nickel(2+) (2:1) | nickel borofluoride | nickel fluoroborate | nickel(II) tetrafluoroborate | nickelous ditetrafluoroborate mass fractions | B (boron) 9.31% | F (fluorine) 65.4% | Ni (nickel) 25.3%
formula | Ni(BF_4)_2 Hill formula | B_2F_8Ni name | nickel(II) fluoborate IUPAC name | nickelous ditetrafluoroborate alternate names | borate(1-), tetrafluoro-, nickel(2+) (2:1) | nickel borofluoride | nickel fluoroborate | nickel(II) tetrafluoroborate | nickelous ditetrafluoroborate mass fractions | B (boron) 9.31% | F (fluorine) 65.4% | Ni (nickel) 25.3%

Structure diagram

Structure diagram
Structure diagram

Basic properties

molar mass | 232.3 g/mol phase | liquid (at STP) boiling point | 100 °C density | 1.454 g/cm^3
molar mass | 232.3 g/mol phase | liquid (at STP) boiling point | 100 °C density | 1.454 g/cm^3

Units

Liquid properties (at STP)

density | 1.454 g/cm^3
density | 1.454 g/cm^3

Units

Chemical identifiers

CAS number | 14708-14-6 PubChem CID number | 61765 SMILES identifier | [B-](F)(F)(F)F.[B-](F)(F)(F)F.[Ni+2] InChI identifier | InChI=1/2BF4.Ni/c2*2-1(3, 4)5;/q2*-1;+2 RTECS number | QR6650000 MDL number | MFCD00016249
CAS number | 14708-14-6 PubChem CID number | 61765 SMILES identifier | [B-](F)(F)(F)F.[B-](F)(F)(F)F.[Ni+2] InChI identifier | InChI=1/2BF4.Ni/c2*2-1(3, 4)5;/q2*-1;+2 RTECS number | QR6650000 MDL number | MFCD00016249

Toxicity properties

odor | odorless
odor | odorless
RTECS classes | agricultural chemical and pesticide
RTECS classes | agricultural chemical and pesticide