Search

InChI identifier of 2-chloro-3-(3-chloro-o-tolyl)propionitrile

Input interpretation

2-chloro-3-(3-chloro-o-tolyl)propionitrile | InChI identifier
2-chloro-3-(3-chloro-o-tolyl)propionitrile | InChI identifier

Result

InChI=1/C10H9Cl2N/c1-7-3-2-4-10(12)9(7)5-8(11)6-13/h2-4, 8H, 5H2, 1H3
InChI=1/C10H9Cl2N/c1-7-3-2-4-10(12)9(7)5-8(11)6-13/h2-4, 8H, 5H2, 1H3

Random Queries

formula of ascorbic acid vs malonic acid
common compound names of platinum vs palladium
HNO3 + Mn = H2O + N2 + Mn(NO3)2
(van der Waals radius of chlorine)/(atomic radius of chlorine)
CAS number of ammonium trifluoromethanesulfonate
name of sodium fluoride vs sodium bromate
alternate names of strontium nitrate vs fluoboric acid
copper(II) cation vs chloride anion vs chromium(III) cation
name of tetrachloroaurate(III) anion
total number of protons of chromium(III) cation vs cobalt(III) cation