Search

name of xenon pentafluoride hexafluoroarsenate

Input interpretation

xenon pentafluoride hexafluoroarsenate
xenon pentafluoride hexafluoroarsenate

Chemical names and formulas

formula | XeF_5AsF_6 Hill formula | AsF_11Xe name | xenon pentafluoride hexafluoroarsenate mass fractions | As (arsenic) 18% | F (fluorine) 50.3% | Xe (xenon) 31.6%
formula | XeF_5AsF_6 Hill formula | AsF_11Xe name | xenon pentafluoride hexafluoroarsenate mass fractions | As (arsenic) 18% | F (fluorine) 50.3% | Xe (xenon) 31.6%

Basic properties

molar mass | 415.197 g/mol melting point | 130.5 °C density | 3.51 g/cm^3
molar mass | 415.197 g/mol melting point | 130.5 °C density | 3.51 g/cm^3

Units

Chemical identifiers

CAS number | 20328-94-3 SMILES identifier | [As-](F)(F)(F)(F)(F)F.F[Xe](F)(F)(F)F
CAS number | 20328-94-3 SMILES identifier | [As-](F)(F)(F)(F)(F)F.F[Xe](F)(F)(F)F

Random Queries

HClO4 = O2 + HCl
vertex coordinates of alkene functional group
formula of tungsten(IV) selenide vs cerium(III) acetate hydrate
density of 1,1'-bicyclopentene
KOH + ZnCl2 = KCl + Zn(OH)2
longest chain thorium silicide
ion electron configuration of manganese(VI) cation vs chromium(III) cation
decay modes of Ac-229 vs Au-193
H2O + B2H6 = H2 + B(OH)3
freezing point of lead(II) chloride