Search

name of xenon pentafluoride hexafluoroarsenate

Input interpretation

xenon pentafluoride hexafluoroarsenate
xenon pentafluoride hexafluoroarsenate

Chemical names and formulas

formula | XeF_5AsF_6 Hill formula | AsF_11Xe name | xenon pentafluoride hexafluoroarsenate mass fractions | As (arsenic) 18% | F (fluorine) 50.3% | Xe (xenon) 31.6%
formula | XeF_5AsF_6 Hill formula | AsF_11Xe name | xenon pentafluoride hexafluoroarsenate mass fractions | As (arsenic) 18% | F (fluorine) 50.3% | Xe (xenon) 31.6%

Basic properties

molar mass | 415.197 g/mol melting point | 130.5 °C density | 3.51 g/cm^3
molar mass | 415.197 g/mol melting point | 130.5 °C density | 3.51 g/cm^3

Units

Chemical identifiers

CAS number | 20328-94-3 SMILES identifier | [As-](F)(F)(F)(F)(F)F.F[Xe](F)(F)(F)F
CAS number | 20328-94-3 SMILES identifier | [As-](F)(F)(F)(F)(F)F.F[Xe](F)(F)(F)F

Random Queries

SMILES identifier of strong acids
chemical types platinum
total number of electrons of magnesium cation vs barium cation
decay modes of Ne-32
isotopes of lanthanum
name of D-threo-aldose functional group vs 2,4-disubstituted quinoline functional group
name of cesium oxalate
IUPAC name of titanium disulfide
1,2-diiodoethane vs 1-iodo-3-phenylpropane
name of sulfuric acid