Search

SMILES identifier of lucifer yellow cH vs 3-methyl-2-oxopentanoic acid sodium salt

Input interpretation

lucifer yellow cH 3-methyl-2-oxopentanoic acid sodium salt | SMILES identifier
lucifer yellow cH 3-methyl-2-oxopentanoic acid sodium salt | SMILES identifier

Results

lucifer yellow cH | [Li+].[Li+].C1=C(C=C2C3=C1C(=O)N(C(=O)C3=CC(=C2N)S(=O)(=O)[O-])NC(=O)NN)S(=O)(=O)[O-] 3-methyl-2-oxopentanoic acid sodium salt | CCC(C)C(=O)C(=O)[O-].[Na+]
lucifer yellow cH | [Li+].[Li+].C1=C(C=C2C3=C1C(=O)N(C(=O)C3=CC(=C2N)S(=O)(=O)[O-])NC(=O)NN)S(=O)(=O)[O-] 3-methyl-2-oxopentanoic acid sodium salt | CCC(C)C(=O)C(=O)[O-].[Na+]

Random Queries

name of lanthanum(III) chloride hydrate
NFPA label of N-propanol
boiling point of tetrahydrocannabinol
name of lead(II) phthalocyanine vs hydroxylamine-15 nhydrochloride
CAS number of lucifer yellow cH vs ribavirin monophosphate
InChI key of formic acid
chemical types of potassium iodide vs sodium chloride
molar mass of niobium pentoxide
alternate names of mercury ions
InChI identifier of s-2-(boronoethyl)-L-cysteine