Search

bis(benzonitrile)palladium(II) chloride

Input interpretation

bis(benzonitrile)palladium(II) chloride
bis(benzonitrile)palladium(II) chloride

Chemical names and formulas

formula | (C_6H_5CN)_2PdCl_2 Hill formula | C_14H_10Cl_2N_2Pd name | bis(benzonitrile)palladium(II) chloride IUPAC name | benzonitrile; dichloropalladium alternate names | benzonitrile; dichloropalladium | bis(benzonitrile)dichloropalladium | palladium, bis(benzonitrile)dichloro- | palladium(II) chloride bis(benzonitrile)complex mass fractions | C (carbon) 43.8% | Cl (chlorine) 18.5% | H (hydrogen) 2.63% | N (nitrogen) 7.3% | Pd (palladium) 27.7%
formula | (C_6H_5CN)_2PdCl_2 Hill formula | C_14H_10Cl_2N_2Pd name | bis(benzonitrile)palladium(II) chloride IUPAC name | benzonitrile; dichloropalladium alternate names | benzonitrile; dichloropalladium | bis(benzonitrile)dichloropalladium | palladium, bis(benzonitrile)dichloro- | palladium(II) chloride bis(benzonitrile)complex mass fractions | C (carbon) 43.8% | Cl (chlorine) 18.5% | H (hydrogen) 2.63% | N (nitrogen) 7.3% | Pd (palladium) 27.7%

Structure diagram

Structure diagram
Structure diagram

Basic properties

molar mass | 383.6 g/mol phase | solid (at STP) melting point | 131 °C solubility in water | insoluble
molar mass | 383.6 g/mol phase | solid (at STP) melting point | 131 °C solubility in water | insoluble

Units

Chemical identifiers

CAS number | 14220-64-5 Beilstein number | 3981730 PubChem CID number | 498840 PubChem SID number | 24853396 SMILES identifier | C1=CC=C(C=C1)C#N.C1=CC=C(C=C1)C#N.Cl[Pd]Cl InChI identifier | InChI=1/2C7H5N.2ClH.Pd/c2*8-6-7-4-2-1-3-5-7;;;/h2*1-5H;2*1H;/q;;;;+2/p-2/f2C7H5N.2Cl.Pd/h;;2*1h;/q;;2*-1;m MDL number | MFCD00013123
CAS number | 14220-64-5 Beilstein number | 3981730 PubChem CID number | 498840 PubChem SID number | 24853396 SMILES identifier | C1=CC=C(C=C1)C#N.C1=CC=C(C=C1)C#N.Cl[Pd]Cl InChI identifier | InChI=1/2C7H5N.2ClH.Pd/c2*8-6-7-4-2-1-3-5-7;;;/h2*1-5H;2*1H;/q;;;;+2/p-2/f2C7H5N.2Cl.Pd/h;;2*1h;/q;;2*-1;m MDL number | MFCD00013123

NFPA label

NFPA label
NFPA label
NFPA health rating | 1 NFPA fire rating | 0 NFPA reactivity rating | 0
NFPA health rating | 1 NFPA fire rating | 0 NFPA reactivity rating | 0

Random Queries

chemical types of (2-methyl-1-propenyl)benzene
formula calcium hydride
SMILES identifier of chromic acid
vertex types of potassium hexacyanomanganate(III)
hybridization of norethindrone
molar mass of chromium tribromide vs 4-bromo-2-(trifluoromethoxy)benzene sulfonyl chloride
name of boron anion
NFPA reactivity rating of sodium sulfide
chemical uses methanol
SMILES identifier of diprotic acids