Search

name of 3-chlorophenylzinc iodide

Input interpretation

3-chlorophenylzinc iodide
3-chlorophenylzinc iodide

Chemical names and formulas

formula | ClC_6H_4ZnI Hill formula | C_6H_4ClIZn name | 3-chlorophenylzinc iodide IUPAC name | chlorobenzene; iodozinc alternate names | chlorobenzene; iodozinc mass fractions | C (carbon) 23.7% | Cl (chlorine) 11.7% | H (hydrogen) 1.33% | I (iodine) 41.8% | Zn (zinc) 21.5%
formula | ClC_6H_4ZnI Hill formula | C_6H_4ClIZn name | 3-chlorophenylzinc iodide IUPAC name | chlorobenzene; iodozinc alternate names | chlorobenzene; iodozinc mass fractions | C (carbon) 23.7% | Cl (chlorine) 11.7% | H (hydrogen) 1.33% | I (iodine) 41.8% | Zn (zinc) 21.5%

Structure diagram

Structure diagram
Structure diagram

Basic properties

molar mass | 303.8 g/mol density | 1.032 g/cm^3
molar mass | 303.8 g/mol density | 1.032 g/cm^3

Units

Chemical identifiers

CAS number | 186000-42-0 PubChem CID number | 4447142 PubChem SID number | 24873150 SMILES identifier | C1=CC(=C[C-]=C1)Cl.[Zn+]I InChI identifier | InChI=1/C6H4Cl.HI.Zn/c7-6-4-2-1-3-5-6;;/h1-2, 4-5H;1H;/q-1;;+2/p-1/fC6H4Cl.I.Zn/h;1h;/qm;-1;m/rC6H4Cl.IZn/c7-6-4-2-1-3-5-6;1-2/h1-2, 4-5H;/q-1;+1 MDL number | MFCD01311393
CAS number | 186000-42-0 PubChem CID number | 4447142 PubChem SID number | 24873150 SMILES identifier | C1=CC(=C[C-]=C1)Cl.[Zn+]I InChI identifier | InChI=1/C6H4Cl.HI.Zn/c7-6-4-2-1-3-5-6;;/h1-2, 4-5H;1H;/q-1;;+2/p-1/fC6H4Cl.I.Zn/h;1h;/qm;-1;m/rC6H4Cl.IZn/c7-6-4-2-1-3-5-6;1-2/h1-2, 4-5H;/q-1;+1 MDL number | MFCD01311393

Safety properties

flash point | -17.22 °C
flash point | -17.22 °C

Random Queries

ion class of cobalt(III) cation vs iron(III) cation
iron(II) selenide vs hydrogen telluride
structure diagram of sulfide anion vs nitride anion
MDL number of potassium vs mercury(II) fluoride
selenide anion structure
density of trisodium phosphate vs bis(2-ethylhexyl) sodium sulfosuccinate
color of alstonite
Fe(NO3)2 = O2 + NO2 + Fe2O3
DOT numbers of magnesium oxide vs rubidium
density of jervisite vs lemmleinite-Ba