Search

InChI identifier of 2-chloro-4-fluorotoluene-α-13 C

Input interpretation

2-chloro-4-fluorotoluene-α-13 C | InChI identifier
2-chloro-4-fluorotoluene-α-13 C | InChI identifier

Result

InChI=1/C7H6ClF/c1-5-2-3-6(9)4-7(5)8/h2-4H, 1H3/i1+1
InChI=1/C7H6ClF/c1-5-2-3-6(9)4-7(5)8/h2-4H, 1H3/i1+1

Random Queries

density of copper vs gallium
H2S + HClO3 = H2O + HCl + S
molar mass of potassium hexachlororuthenate(III)
non-standard isotope counts of heteronuclear diatomic molecules
phosphorus pentachloride vs scandium
chemical types of ytterbium(III) chloride hexahydrate vs ammonium-15 N2 sulfate
H2O + HNO3 + As2S3 = H2SO4 + NO + H3As4
formula of barium silicide
molar mass of L-tryptophan
Cl2 + Br2 = BrCl