Search

name of sodium 5-formylfuran-2-sulfonate

Input interpretation

sodium 5-formylfuran-2-sulfonate
sodium 5-formylfuran-2-sulfonate

Chemical names and formulas

formula | C_5H_3NaO_5S name | sodium 5-formylfuran-2-sulfonate alternate names | 2-furansulfonic acid, 5-formyl-, sodium salt | sodium 5-formylfuran-2-sulphonate mass fractions | C (carbon) 30.3% | H (hydrogen) 1.53% | Na (sodium) 11.6% | O (oxygen) 40.4% | S (sulfur) 16.2%
formula | C_5H_3NaO_5S name | sodium 5-formylfuran-2-sulfonate alternate names | 2-furansulfonic acid, 5-formyl-, sodium salt | sodium 5-formylfuran-2-sulphonate mass fractions | C (carbon) 30.3% | H (hydrogen) 1.53% | Na (sodium) 11.6% | O (oxygen) 40.4% | S (sulfur) 16.2%

Structure diagram

Structure diagram
Structure diagram
vertex count | 12 edge count | 11 Schultz index | 620 Wiener index | 153 Hosoya index | 120 Balaban index | 2.415
vertex count | 12 edge count | 11 Schultz index | 620 Wiener index | 153 Hosoya index | 120 Balaban index | 2.415

Basic properties

molar mass | 198.12 g/mol phase | solid (at STP) melting point | 300 °C
molar mass | 198.12 g/mol phase | solid (at STP) melting point | 300 °C

Units

Chemical identifiers

CAS number | 31795-44-5 Beilstein number | 4340591 PubChem CID number | 2724000 SMILES identifier | C1=C(OC(=C1)S(=O)(=O)[O-])C=O.[Na+] InChI identifier | InChI=1/C5H4O5S.Na/c6-3-4-1-2-5(10-4)11(7, 8)9;/h1-3H, (H, 7, 8, 9);/q;+1/p-1/fC5H3O5S.Na/q-1;m EU number | 250-810-5
CAS number | 31795-44-5 Beilstein number | 4340591 PubChem CID number | 2724000 SMILES identifier | C1=C(OC(=C1)S(=O)(=O)[O-])C=O.[Na+] InChI identifier | InChI=1/C5H4O5S.Na/c6-3-4-1-2-5(10-4)11(7, 8)9;/h1-3H, (H, 7, 8, 9);/q;+1/p-1/fC5H3O5S.Na/q-1;m EU number | 250-810-5

NFPA label

NFPA label
NFPA label
NFPA health rating | 1 NFPA fire rating | 0 NFPA reactivity rating | 0
NFPA health rating | 1 NFPA fire rating | 0 NFPA reactivity rating | 0