name of hydroxyethylcysteine

hydroxyethylcysteine

formula | C_5H_11NO_3S name | hydroxyethylcysteine IUPAC name | 2-amino-3-[(2-hydroxyethyl)sulfanyl]propanoic acid mass fractions | C (carbon) 36.4% | H (hydrogen) 6.71% | N (nitrogen) 8.48% | O (oxygen) 29.1% | S (sulfur) 19.4%

Draw the Lewis structure of hydroxyethylcysteine. Start by drawing the overall structure of the molecule, ignoring potential double and triple bonds: Count the total valence electrons of the carbon (n_C, val = 4), hydrogen (n_H, val = 1), nitrogen (n_N, val = 5), oxygen (n_O, val = 6), and sulfur (n_S, val = 6) atoms: 5 n_C, val + 11 n_H, val + n_N, val + 3 n_O, val + n_S, val = 60 Calculate the number of electrons needed to completely fill the valence shells for carbon (n_C, full = 8), hydrogen (n_H, full = 2), nitrogen (n_N, full = 8), oxygen (n_O, full = 8), and sulfur (n_S, full = 8): 5 n_C, full + 11 n_H, full + n_N, full + 3 n_O, full + n_S, full = 102 Subtracting these two numbers shows that 102 - 60 = 42 bonding electrons are needed. Each bond has two electrons, so in addition to the 20 bonds already present in the diagram add 1 bond. To minimize formal charge carbon wants 4 bonds and oxygen wants 2 bonds. Identify the atoms that want additional bonds and the number of electrons remaining on each atom: Fill in the 1 bond by pairing electrons between adjacent highlighted atoms: Answer: | |

molar mass | 165.2 g/mol phase | solid (at STP)

predicted LogP hydrophobicity | -2.64 predicted LogS | -0.63

approval status | experimental | small molecule

SMILES identifier | NC(CSCCO)C(O)=O InChI identifier | InChI=1/C5H11NO3S/c6-4(5(8)9)3-10-2-1-7/h4, 7H, 1-3, 6H2, (H, 8, 9)/f/h8H InChI key | MWFRVMDVLYIXJF-FZOZFQFYCR