Input interpretation
3-(N, N-dimethylamino)phenylboronic acid
Chemical names and formulas
formula | C_8H_12BNO_2 name | 3-(N, N-dimethylamino)phenylboronic acid IUPAC name | (3-dimethylaminophenyl)boronic acid alternate names | (3-dimethylaminophenyl)boronic acid mass fractions | B (boron) 6.55% | C (carbon) 58.2% | H (hydrogen) 7.33% | N (nitrogen) 8.49% | O (oxygen) 19.4%
Lewis structure
Draw the Lewis structure of 3-(N, N-dimethylamino)phenylboronic acid. Start by drawing the overall structure of the molecule, ignoring potential double and triple bonds: Count the total valence electrons of the boron (n_B, val = 3), carbon (n_C, val = 4), hydrogen (n_H, val = 1), nitrogen (n_N, val = 5), and oxygen (n_O, val = 6) atoms: n_B, val + 8 n_C, val + 12 n_H, val + n_N, val + 2 n_O, val = 64 Calculate the number of electrons needed to completely fill the valence shells for boron (n_B, full = 6), carbon (n_C, full = 8), hydrogen (n_H, full = 2), nitrogen (n_N, full = 8), and oxygen (n_O, full = 8): n_B, full + 8 n_C, full + 12 n_H, full + n_N, full + 2 n_O, full = 118 Subtracting these two numbers shows that 118 - 64 = 54 bonding electrons are needed. Each bond has two electrons, so in addition to the 24 bonds already present in the diagram add 3 bonds. To minimize formal charge carbon wants 4 bonds. Identify the atoms that want additional bonds and the number of electrons remaining on each atom: Fill in the 3 bonds by pairing electrons between adjacent highlighted atoms. Note that the six atom ring is aromatic, so that the single and double bonds may be rearranged: Answer: | |
Basic properties
molar mass | 165 g/mol phase | solid (at STP) melting point | 184 °C
Units
Chemical identifiers
CAS number | 178752-79-9 PubChem CID number | 2762527 PubChem SID number | 24885572 SMILES identifier | B(C1=CC(=CC=C1)N(C)C)(O)O InChI identifier | InChI=1/C8H12BNO2/c1-10(2)8-5-3-4-7(6-8)9(11)12/h3-6, 11-12H, 1-2H3 MDL number | MFCD01318996