Search

name of bis(pentafluorophenyl)zinc

Input interpretation

bis(pentafluorophenyl)zinc
bis(pentafluorophenyl)zinc

Chemical names and formulas

formula | (C_6F_5)_2Zn Hill formula | C_12F_10Zn name | bis(pentafluorophenyl)zinc IUPAC name | zinc 1, 2, 3, 4, 5-pentafluorobenzene-6-ide alternate names | zinc 1, 2, 3, 4, 5-pentafluorobenzene-6-ide mass fractions | C (carbon) 36.1% | F (fluorine) 47.6% | Zn (zinc) 16.4%
formula | (C_6F_5)_2Zn Hill formula | C_12F_10Zn name | bis(pentafluorophenyl)zinc IUPAC name | zinc 1, 2, 3, 4, 5-pentafluorobenzene-6-ide alternate names | zinc 1, 2, 3, 4, 5-pentafluorobenzene-6-ide mass fractions | C (carbon) 36.1% | F (fluorine) 47.6% | Zn (zinc) 16.4%

Structure diagram

Structure diagram
Structure diagram

Basic properties

molar mass | 399.5 g/mol phase | solid (at STP) melting point | 102.5 °C
molar mass | 399.5 g/mol phase | solid (at STP) melting point | 102.5 °C

Units

Chemical identifiers

CAS number | 1799-90-2 PubChem CID number | 3495745 PubChem SID number | 24880317 SMILES identifier | [C-]1=C(C(=C(C(=C1F)F)F)F)F.[C-]1=C(C(=C(C(=C1F)F)F)F)F.[Zn+2] InChI identifier | InChI=1/2C6F5.Zn/c2*7-2-1-3(8)5(10)6(11)4(2)9;/q2*-1;+2 MDL number | MFCD03701564
CAS number | 1799-90-2 PubChem CID number | 3495745 PubChem SID number | 24880317 SMILES identifier | [C-]1=C(C(=C(C(=C1F)F)F)F)F.[C-]1=C(C(=C(C(=C1F)F)F)F)F.[Zn+2] InChI identifier | InChI=1/2C6F5.Zn/c2*7-2-1-3(8)5(10)6(11)4(2)9;/q2*-1;+2 MDL number | MFCD03701564