Search

name of potassium 4-acetylphenyltrifluoroborate

Input interpretation

potassium 4-acetylphenyltrifluoroborate
potassium 4-acetylphenyltrifluoroborate

Chemical names and formulas

formula | C_8H_7BF_3KO name | potassium 4-acetylphenyltrifluoroborate IUPAC name | potassium (4-acetylphenyl)-trifluoroboron alternate names | potassium (4-acetylphenyl)-trifluoro-boron | potassium (4-acetylphenyl)-trifluoroboron | potassium (4-ethanoylphenyl)-trifluoro-boron mass fractions | B (boron) 4.78% | C (carbon) 42.5% | F (fluorine) 25.2% | H (hydrogen) 3.12% | K (potassium) 17.3% | O (oxygen) 7.08%
formula | C_8H_7BF_3KO name | potassium 4-acetylphenyltrifluoroborate IUPAC name | potassium (4-acetylphenyl)-trifluoroboron alternate names | potassium (4-acetylphenyl)-trifluoro-boron | potassium (4-acetylphenyl)-trifluoroboron | potassium (4-ethanoylphenyl)-trifluoro-boron mass fractions | B (boron) 4.78% | C (carbon) 42.5% | F (fluorine) 25.2% | H (hydrogen) 3.12% | K (potassium) 17.3% | O (oxygen) 7.08%

Structure diagram

Structure diagram
Structure diagram
vertex count | 14 edge count | 13 Schultz index | 1005 Wiener index | 252 Hosoya index | 276 Balaban index | 2.392
vertex count | 14 edge count | 13 Schultz index | 1005 Wiener index | 252 Hosoya index | 276 Balaban index | 2.392

Basic properties

molar mass | 226.05 g/mol phase | solid (at STP) melting point | 290 °C
molar mass | 226.05 g/mol phase | solid (at STP) melting point | 290 °C

Units

Chemical identifiers

CAS number | 252726-24-2 PubChem CID number | 23665673 PubChem SID number | 24884259 SMILES identifier | [B-](C1=CC=C(C=C1)C(=O)C)(F)(F)F.[K+] InChI identifier | InChI=1/C8H7BF3O.K/c1-6(13)7-2-4-8(5-3-7)9(10, 11)12;/h2-5H, 1H3;/q-1;+1 MDL number | MFCD07784376
CAS number | 252726-24-2 PubChem CID number | 23665673 PubChem SID number | 24884259 SMILES identifier | [B-](C1=CC=C(C=C1)C(=O)C)(F)(F)F.[K+] InChI identifier | InChI=1/C8H7BF3O.K/c1-6(13)7-2-4-8(5-3-7)9(10, 11)12;/h2-5H, 1H3;/q-1;+1 MDL number | MFCD07784376