Search

InChI identifier of benzo[a]pyrene-d 12

Input interpretation

benzo[a]pyrene-d 12 | InChI identifier
benzo[a]pyrene-d 12 | InChI identifier

Result

InChI=1/C20H12/c1-2-7-17-15(4-1)12-16-9-8-13-5-3-6-14-10-11-18(17)20(16)19(13)14/h1-12H/i1D, 2D, 3D, 4D, 5D, 6D, 7D, 8D, 9D, 10D, 11D, 12D
InChI=1/C20H12/c1-2-7-17-15(4-1)12-16-9-8-13-5-3-6-14-10-11-18(17)20(16)19(13)14/h1-12H/i1D, 2D, 3D, 4D, 5D, 6D, 7D, 8D, 9D, 10D, 11D, 12D

Random Queries

melting point of carbon vs tin
molar mass of copper(II) chloride vs calcium telluride
molar mass of lithium selenite monohydrate
alternate names of liquid elements
first molar ionization energies of group 12 elements
iron(II) phosphate octahydrate vs plaster of paris
vertex types of 2 ethylhexyl methacrylate
discovery year of reedmergnerite
H2O + Na2SO4 = O2 + H2 + NaOH + SO2
ionic diatomics