Input interpretation
2, 4'-dibromopropiophenone
Chemical names and formulas
formula | BrC_6H_4COCH(Br)CH_3 Hill formula | C_9H_8Br_2O name | 2, 4'-dibromopropiophenone IUPAC name | 2-bromo-1-(4-bromophenyl)propan-1-one alternate names | 2-bromo-1-(4-bromophenyl)propan-1-one mass fractions | Br (bromine) 54.7% | C (carbon) 37% | H (hydrogen) 2.76% | O (oxygen) 5.48%
Lewis structure
Draw the Lewis structure of 2, 4'-dibromopropiophenone. Start by drawing the overall structure of the molecule, ignoring potential double and triple bonds: Count the total valence electrons of the bromine (n_Br, val = 7), carbon (n_C, val = 4), hydrogen (n_H, val = 1), and oxygen (n_O, val = 6) atoms: 2 n_Br, val + 9 n_C, val + 8 n_H, val + n_O, val = 64 Calculate the number of electrons needed to completely fill the valence shells for bromine (n_Br, full = 8), carbon (n_C, full = 8), hydrogen (n_H, full = 2), and oxygen (n_O, full = 8): 2 n_Br, full + 9 n_C, full + 8 n_H, full + n_O, full = 112 Subtracting these two numbers shows that 112 - 64 = 48 bonding electrons are needed. Each bond has two electrons, so in addition to the 20 bonds already present in the diagram add 4 bonds. To minimize formal charge oxygen wants 2 bonds and carbon wants 4 bonds. Identify the atoms that want additional bonds and the number of electrons remaining on each atom: Fill in the 4 bonds by pairing electrons between adjacent highlighted atoms. Note that the six atom ring is aromatic, so that the single and double bonds may be rearranged: Answer: | |
3D structure
3D structure
Basic properties
molar mass | 291.97 g/mol phase | solid (at STP) melting point | 86.5 °C
Units
Chemical identifiers
CAS number | 38786-67-3 PubChem CID number | 603907 PubChem SID number | 24863963 SMILES identifier | CC(C(=O)C1=CC=C(C=C1)Br)Br InChI identifier | InChI=1/C9H8Br2O/c1-6(10)9(12)7-2-4-8(11)5-3-7/h2-6H, 1H3 MDL number | MFCD00209571