dichloromethyl trichlorosilyl ethyl silane

dichloromethyl trichlorosilyl ethyl silane

molar mass | 276.5 g/mol formula | C_3H_7Cl_5Si_2 empirical formula | Cl_5C_3Si_2H_7 SMILES identifier | CC[SiH](C(Cl)Cl)[Si](Cl)(Cl)Cl InChI identifier | InChI=1/C3H7Cl5Si2/c1-2-9(3(4)5)10(6, 7)8/h3, 9H, 2H2, 1H3 InChI key | ZVHUTOXHFUWGRL-UHFFFAOYSA-N

Draw the Lewis structure of dichloromethyl trichlorosilyl ethyl silane. Start by drawing the overall structure of the molecule: Count the total valence electrons of the carbon (n_C, val = 4), chlorine (n_Cl, val = 7), hydrogen (n_H, val = 1), and silicon (n_Si, val = 4) atoms: 3 n_C, val + 5 n_Cl, val + 7 n_H, val + 2 n_Si, val = 62 Calculate the number of electrons needed to completely fill the valence shells for carbon (n_C, full = 8), chlorine (n_Cl, full = 8), hydrogen (n_H, full = 2), and silicon (n_Si, full = 8): 3 n_C, full + 5 n_Cl, full + 7 n_H, full + 2 n_Si, full = 94 Subtracting these two numbers shows that 94 - 62 = 32 bonding electrons are needed. Each bond has two electrons, so the above diagram has all the necessary bonds. There are 16 bonds and hence 32 bonding electrons in the diagram. Lastly, fill in the remaining unbonded electrons on each atom. In total, there remain 62 - 32 = 30 electrons left to draw: Answer: | |

longest chain length | 5 atoms longest straight chain length | 5 atoms longest aliphatic chain length | 2 atoms aromatic atom count | 0 atoms H-bond acceptor count | 0 atoms H-bond donor count | 0 atoms

Find the elemental composition for dichloromethyl trichlorosilyl ethyl silane in terms of the atom and mass percents: atom percent = N_i/N_atoms × 100% mass percent = (N_im_i)/m × 100% Plan: • Write the chemical formula and gather atomic masses from the periodic table. • Determine values for N_i, m_i, N_atoms and m using these items. • Finally, compute the percents and check the results. Write the chemical formula: C_3H_7Cl_5Si_2 Use the chemical formula to count the number of atoms, N_i, for each element and find the total number of atoms, N_atoms, per molecule: | number of atoms Cl (chlorine) | 5 C (carbon) | 3 Si (silicon) | 2 H (hydrogen) | 7 N_atoms = 5 + 3 + 2 + 7 = 17 Divide each N_i by N_atoms to calculate atom fractions. Then use the property that atom fractions must sum to one to check the work: | number of atoms | atom fraction Cl (chlorine) | 5 | 5/17 C (carbon) | 3 | 3/17 Si (silicon) | 2 | 2/17 H (hydrogen) | 7 | 7/17 Check: 5/17 + 3/17 + 2/17 + 7/17 = 1 Compute atom percents using the atom fractions: | number of atoms | atom percent Cl (chlorine) | 5 | 5/17 × 100% = 29.4% C (carbon) | 3 | 3/17 × 100% = 17.6% Si (silicon) | 2 | 2/17 × 100% = 11.8% H (hydrogen) | 7 | 7/17 × 100% = 41.2% Look up the atomic mass, m_i, in unified atomic mass units, u, for each element in the periodic table: | number of atoms | atom percent | atomic mass/u Cl (chlorine) | 5 | 29.4% | 35.45 C (carbon) | 3 | 17.6% | 12.011 Si (silicon) | 2 | 11.8% | 28.085 H (hydrogen) | 7 | 41.2% | 1.008 Multiply N_i by m_i to compute the mass for each element. Then sum those values to compute the molecular mass, m: | number of atoms | atom percent | atomic mass/u | mass/u Cl (chlorine) | 5 | 29.4% | 35.45 | 5 × 35.45 = 177.25 C (carbon) | 3 | 17.6% | 12.011 | 3 × 12.011 = 36.033 Si (silicon) | 2 | 11.8% | 28.085 | 2 × 28.085 = 56.170 H (hydrogen) | 7 | 41.2% | 1.008 | 7 × 1.008 = 7.056 m = 177.25 u + 36.033 u + 56.170 u + 7.056 u = 276.509 u Divide the mass for each element by m to calculate mass fractions. Then use the property that mass fractions must sum to one to check the work: | number of atoms | atom percent | mass fraction Cl (chlorine) | 5 | 29.4% | 177.25/276.509 C (carbon) | 3 | 17.6% | 36.033/276.509 Si (silicon) | 2 | 11.8% | 56.170/276.509 H (hydrogen) | 7 | 41.2% | 7.056/276.509 Check: 177.25/276.509 + 36.033/276.509 + 56.170/276.509 + 7.056/276.509 = 1 Compute mass percents using the mass fractions: Answer: | | | number of atoms | atom percent | mass percent Cl (chlorine) | 5 | 29.4% | 177.25/276.509 × 100% = 64.10% C (carbon) | 3 | 17.6% | 36.033/276.509 × 100% = 13.03% Si (silicon) | 2 | 11.8% | 56.170/276.509 × 100% = 20.31% H (hydrogen) | 7 | 41.2% | 7.056/276.509 × 100% = 2.552%

The first step in finding the oxidation states (or oxidation numbers) in dichloromethyl trichlorosilyl ethyl silane is to draw the structure diagram. Next set every oxidation number equal to the atom's formal charge: There are 2 carbon-chlorine bonds, 6 carbon-hydrogen bonds, 2 carbon-silicon bonds, 3 chlorine-silicon bonds, 1 silicon-hydrogen bond, 1 carbon-carbon bond, and 1 silicon-silicon bond in dichloromethyl trichlorosilyl ethyl silane. For each of these bonds, assign the bonding electrons to the most electronegative element. First examine the carbon-chlorine bonds: element | electronegativity (Pauling scale) | C | 2.55 | Cl | 3.16 | | | Since chlorine is more electronegative than carbon, the electrons in these bonds will go to chlorine. Decrease the oxidation number for chlorine in every highlighted bond (by 1 for single bonds, 2 for double bonds, and 3 for triple bonds), and increase the oxidation number for carbon accordingly: Next look at the carbon-hydrogen bonds: element | electronegativity (Pauling scale) | C | 2.55 | H | 2.20 | | | Since carbon is more electronegative than hydrogen, the electrons in these bonds will go to carbon: Next look at the carbon-silicon bonds: element | electronegativity (Pauling scale) | C | 2.55 | Si | 1.90 | | | Since carbon is more electronegative than silicon, the electrons in these bonds will go to carbon: Next look at the chlorine-silicon bonds: element | electronegativity (Pauling scale) | Cl | 3.16 | Si | 1.90 | | | Since chlorine is more electronegative than silicon, the electrons in these bonds will go to chlorine: Next look at the silicon-hydrogen bond: element | electronegativity (Pauling scale) | Si | 1.90 | H | 2.20 | | | Since hydrogen is more electronegative than silicon, the electrons in this bond will go to hydrogen: Next look at the carbon-carbon bond: element | electronegativity (Pauling scale) | C | 2.55 | C | 2.55 | | | Since these elements are the same the bonding electrons are shared equally, and there is no change to the oxidation states: Next look at the silicon-silicon bond: element | electronegativity (Pauling scale) | Si | 1.90 | Si | 1.90 | | | Since these elements are the same the bonding electrons are shared equally, and there is no change to the oxidation states: Now summarize the results: Answer: | | oxidation state | element | count -3 | C (carbon) | 2 -1 | Cl (chlorine) | 5 | H (hydrogen) | 1 0 | C (carbon) | 1 +1 | H (hydrogen) | 6 +3 | Si (silicon) | 2

First draw the structure diagram for dichloromethyl trichlorosilyl ethyl silane, and for every non-hydrogen atom, count the σ-bonds. Note that double and triple bonds consist of one σ-bond together with one or two π-bonds: Identify those atoms with lone pairs: Find the steric number by adding the lone pair count to the number of σ-bonds: Consult the following chart to determine the hybridization from the steric number: steric number | hybridization 2 | sp 3 | sp^2 4 | sp^3 5 | dsp^3 6 | d^2sp^3 7 | d^3sp^3 Now assign the hybridization for each atom: Answer: | |

vertex count | 17 edge count | 16 Schultz index | 1492 Wiener index | 418 Hosoya index | 584 Balaban index | 6.036