methyl 5-bromo-2-iodobenzoate

methyl 5-bromo-2-iodobenzoate

formula | BrC_6H_3(I)CO_2CH_3 Hill formula | C_8H_6BrIO_2 name | methyl 5-bromo-2-iodobenzoate IUPAC name | 5-bromo-2-iodobenzoic acid methyl ester alternate names | 5-bromo-2-iodo-benzoic acid methyl ester | methyl 5-bromo-2-iodo-benzoate mass fractions | Br (bromine) 23.4% | C (carbon) 28.2% | H (hydrogen) 1.77% | I (iodine) 37.2% | O (oxygen) 9.39%

Draw the Lewis structure of methyl 5-bromo-2-iodobenzoate. Start by drawing the overall structure of the molecule, ignoring potential double and triple bonds: Count the total valence electrons of the bromine (n_Br, val = 7), carbon (n_C, val = 4), hydrogen (n_H, val = 1), iodine (n_I, val = 7), and oxygen (n_O, val = 6) atoms: n_Br, val + 8 n_C, val + 6 n_H, val + n_I, val + 2 n_O, val = 64 Calculate the number of electrons needed to completely fill the valence shells for bromine (n_Br, full = 8), carbon (n_C, full = 8), hydrogen (n_H, full = 2), iodine (n_I, full = 8), and oxygen (n_O, full = 8): n_Br, full + 8 n_C, full + 6 n_H, full + n_I, full + 2 n_O, full = 108 Subtracting these two numbers shows that 108 - 64 = 44 bonding electrons are needed. Each bond has two electrons, so in addition to the 18 bonds already present in the diagram add 4 bonds. To minimize formal charge oxygen wants 2 bonds and carbon wants 4 bonds. Identify the atoms that want additional bonds and the number of electrons remaining on each atom: Fill in the 4 bonds by pairing electrons between adjacent highlighted atoms. Note that the six atom ring is aromatic, so that the single and double bonds may be rearranged: Answer: | |

3D structure

molar mass | 340.94 g/mol phase | solid (at STP) melting point | 47 °C

CAS number | 181765-86-6 PubChem CID number | 11078356 PubChem SID number | 24883892 SMILES identifier | COC(=O)C1=C(C=CC(=C1)Br)I InChI identifier | InChI=1/C8H6BrIO2/c1-12-8(11)6-4-5(9)2-3-7(6)10/h2-4H, 1H3 MDL number | MFCD00144771

flash point | 110 °C