Search

soda ash

Input interpretation

soda ash
soda ash

Chemical names and formulas

formula | Na_2CO_3 Hill formula | CNa_2O_3 name | soda ash IUPAC name | disodium carbonate alternate names | crystol carbonate | disodium carbonate | soda | sodium carbonate mass fractions | C (carbon) 11.3% | Na (sodium) 43.4% | O (oxygen) 45.3%
formula | Na_2CO_3 Hill formula | CNa_2O_3 name | soda ash IUPAC name | disodium carbonate alternate names | crystol carbonate | disodium carbonate | soda | sodium carbonate mass fractions | C (carbon) 11.3% | Na (sodium) 43.4% | O (oxygen) 45.3%

Structure diagram

Structure diagram
Structure diagram
vertex count | 6 edge count | 3 Schultz index | 36 Wiener index | 9 Hosoya index | 4 Balaban index | 2.324
vertex count | 6 edge count | 3 Schultz index | 36 Wiener index | 9 Hosoya index | 4 Balaban index | 2.324

Basic properties

molar mass | 105.99 g/mol phase | solid (at STP) melting point | 851 °C boiling point | 1600 °C solubility in water | soluble
molar mass | 105.99 g/mol phase | solid (at STP) melting point | 851 °C boiling point | 1600 °C solubility in water | soluble

Units

Solid properties (at STP)

refractive index | 1.495
refractive index | 1.495

Thermodynamic properties

specific heat capacity c_p | solid | 1.06 J/(g K) molar heat capacity c_p | solid | 112.3 J/(mol K) specific free energy of formation Δ_fG° | solid | -9.854 kJ/g molar free energy of formation Δ_fG° | solid | -1044 kJ/mol specific heat of formation Δ_fH° | solid | -10.67 kJ/g molar heat of formation Δ_fH° | solid | -1131 kJ/mol specific entropy S° | solid | 1.283 J/(g K) molar entropy S° | solid | 136 J/(mol K) molar heat of fusion | 29.7 kJ/mol | specific heat of fusion | 0.28 kJ/g | (at STP)
specific heat capacity c_p | solid | 1.06 J/(g K) molar heat capacity c_p | solid | 112.3 J/(mol K) specific free energy of formation Δ_fG° | solid | -9.854 kJ/g molar free energy of formation Δ_fG° | solid | -1044 kJ/mol specific heat of formation Δ_fH° | solid | -10.67 kJ/g molar heat of formation Δ_fH° | solid | -1131 kJ/mol specific entropy S° | solid | 1.283 J/(g K) molar entropy S° | solid | 136 J/(mol K) molar heat of fusion | 29.7 kJ/mol | specific heat of fusion | 0.28 kJ/g | (at STP)

Chemical identifiers

CAS number | 497-19-8 Beilstein number | 4154566 PubChem CID number | 10340 PubChem SID number | 24852265 SMILES identifier | C(=O)([O-])[O-].[Na+].[Na+] InChI identifier | InChI=1/CH2O3.2Na/c2-1(3)4;;/h(H2, 2, 3, 4);;/q;2*+1/p-2/fCO3.2Na/q-2;2m RTECS number | VZ4050000 MDL number | MFCD00003494
CAS number | 497-19-8 Beilstein number | 4154566 PubChem CID number | 10340 PubChem SID number | 24852265 SMILES identifier | C(=O)([O-])[O-].[Na+].[Na+] InChI identifier | InChI=1/CH2O3.2Na/c2-1(3)4;;/h(H2, 2, 3, 4);;/q;2*+1/p-2/fCO3.2Na/q-2;2m RTECS number | VZ4050000 MDL number | MFCD00003494

NFPA label

NFPA label
NFPA label
NFPA health rating | 3 NFPA fire rating | 0 NFPA reactivity rating | 0
NFPA health rating | 3 NFPA fire rating | 0 NFPA reactivity rating | 0

Toxicity properties

RTECS classes | agricultural chemical and pesticide | mutagen | reproductive effector | human data | primary irritant
RTECS classes | agricultural chemical and pesticide | mutagen | reproductive effector | human data | primary irritant

Ion equivalents

Na^+ (sodium cation) | 2 (CO_3)^(2-) (carbonate anion) | 1
Na^+ (sodium cation) | 2 (CO_3)^(2-) (carbonate anion) | 1

Random Queries

molar mass of cerium(III) sulfide
chemical types of potassium nitrite vs sodium amide
formula of 1-naphthaldehyde vs (2-amino-4-hydroxy-7,8-dihydropteridin-6-yl)methyl diphosphate
vanadium(III) ions
CAS number of 4-bromo-3-fluorophenylzinc iodide vs 5-methyl-2-pyridylzinc bromide
sulfur dioxide vs carbon tetrachloride
alternate names of manganese titanate
total number of protons of calcium cation vs strontium cation
alternate names of thallous malonate
chloride anion vs lead(IV) cation vs manganese(VII) cation vs thallium(I) cation vs sulfide anion