Input interpretation
diammonium hydrogen phosphate
Chemical names and formulas
formula | (NH_4)_2HPO_4 Hill formula | H_9N_2O_4P name | diammonium hydrogen phosphate alternate names | Akoustan A | ammonium hydrogen phosphate | di-ammonium hydrogen phosphate(sec) | Pelor mass fractions | H (hydrogen) 6.87% | N (nitrogen) 21.2% | O (oxygen) 48.5% | P (phosphorus) 23.5%
Structure diagram
Structure diagram
Basic properties
molar mass | 132.06 g/mol phase | solid (at STP) melting point | 155 °C density | 1.619 g/cm^3
Units
Solid properties (at STP)
density | 1.619 g/cm^3 refractive index | 1.53
Units
Thermodynamic properties
specific heat capacity c_p | solid | 1.424 J/(g K) molar heat capacity c_p | solid | 188 J/(mol K) specific heat of formation Δ_fH° | solid | -11.87 kJ/g molar heat of formation Δ_fH° | solid | -1567 kJ/mol (at STP)
Chemical identifiers
![CAS number | 7783-28-0 PubChem CID number | 24540 SMILES identifier | [NH4+].[NH4+].OP(=O)([O-])[O-] InChI identifier | InChI=1/2H3N.H3O4P/c;;1-5(2, 3)4/h2*1H3;(H3, 1, 2, 3, 4)/f2H4N.HO4P/h2*1H;1H/q2*+1;-2 MDL number | MFCD00010891](../image_source/e11833639f90d9c4ab27ae9d641fd52d.png)
CAS number | 7783-28-0 PubChem CID number | 24540 SMILES identifier | [NH4+].[NH4+].OP(=O)([O-])[O-] InChI identifier | InChI=1/2H3N.H3O4P/c;;1-5(2, 3)4/h2*1H3;(H3, 1, 2, 3, 4)/f2H4N.HO4P/h2*1H;1H/q2*+1;-2 MDL number | MFCD00010891
NFPA label
NFPA label
NFPA health rating | 1 NFPA fire rating | 0 NFPA reactivity rating | 0
Toxicity properties
odor | odorless
Ion equivalents
(HPO_4)^(2-) (hydrogen phosphate anion) | 1