name of 2'-deoxy-5-iodouridine 3',5'-diacetate

2'-deoxy-5-iodouridine 3', 5'-diacetate

formula | C_13H_15IN_2O_7 name | 2'-deoxy-5-iodouridine 3', 5'-diacetate IUPAC name | [[3-acetyloxy-5-(2, 4-dioxopyrimidin-1-yl)oxolan-2-yl]-iodo-methyl] acetate alternate names | 3', 5'-diacetyl-5-iodo-2'-deoxyuridine | uridine, 2'-deoxy-5-iodo-, 3', 5'-diacetate mass fractions | C (carbon) 35.6% | H (hydrogen) 3.45% | I (iodine) 29% | N (nitrogen) 6.39% | O (oxygen) 25.6%

Draw the Lewis structure of 2'-deoxy-5-iodouridine 3', 5'-diacetate. Start by drawing the overall structure of the molecule, ignoring potential double and triple bonds: Count the total valence electrons of the carbon (n_C, val = 4), hydrogen (n_H, val = 1), iodine (n_I, val = 7), nitrogen (n_N, val = 5), and oxygen (n_O, val = 6) atoms: 13 n_C, val + 15 n_H, val + n_I, val + 2 n_N, val + 7 n_O, val = 126 Calculate the number of electrons needed to completely fill the valence shells for carbon (n_C, full = 8), hydrogen (n_H, full = 2), iodine (n_I, full = 8), nitrogen (n_N, full = 8), and oxygen (n_O, full = 8): 13 n_C, full + 15 n_H, full + n_I, full + 2 n_N, full + 7 n_O, full = 214 Subtracting these two numbers shows that 214 - 126 = 88 bonding electrons are needed. Each bond has two electrons, so in addition to the 39 bonds already present in the diagram add 5 bonds. To minimize formal charge oxygen wants 2 bonds and carbon wants 4 bonds. Identify the atoms that want additional bonds and the number of electrons remaining on each atom: Fill in the 5 bonds by pairing electrons between adjacent highlighted atoms: Answer: | |

3D structure

molar mass | 438.17 g/mol phase | solid (at STP) melting point | 159 °C

CAS number | 1956-30-5 Beilstein number | 579757 PubChem CID number | 102728 SMILES identifier | CC(=O)OC1CC(OC1C(OC(=O)C)I)N2C=CC(=O)NC2=O InChI identifier | InChI=1/C13H15IN2O7/c1-6(17)21-8-5-10(16-4-3-9(19)15-13(16)20)23-11(8)12(14)22-7(2)18/h3-4, 8, 10-12H, 5H2, 1-2H3, (H, 15, 19, 20)/f/h15H EU number | 217-799-9

NFPA label

NFPA health rating | 1 NFPA fire rating | 0 NFPA reactivity rating | 0