Search

PubChem CID number of chlormequat vs [methyltelluro]acetate

Input interpretation

chlormequat [methyltelluro]acetate | PubChem CID number
chlormequat [methyltelluro]acetate | PubChem CID number

Results

chlormequat | 13836 [methyltelluro]acetate | 1954
chlormequat | 13836 [methyltelluro]acetate | 1954

Random Queries

KI + H3AsO4 = H2O + I2 + K2HAsO3
IUPAC mercury(II) fluoride
KCl = Cl2 + K
molar mass of californium(III) cation
molar mass of berberine sulfate
formula of polonide(2-) anion
molar mass of erbium(III) bromide
InChI=1/C8H8O3/c1-11-8-4-6(5-9)2-3-7(8)10/h2-5,10H,1H3
atomic diameter of protactinium vs actinium
CAS number of tungsten(IV) iodide