Search

InChI identifier of erythorbic acid

Input interpretation

erythorbic acid | InChI identifier
erythorbic acid | InChI identifier

Result

InChI=1/C6H8O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2, 5, 7-8, 10-11H, 1H2/t2-, 5-/m1/s1
InChI=1/C6H8O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2, 5, 7-8, 10-11H, 1H2/t2-, 5-/m1/s1

Random Queries

alternate names of alkyl iodide functional group
formula of lead vs arsenolite
Ba(OH)2 + Na3PO4 = NaOH + Ba3(PO4)2
alternate names of titanyl cation
(Mercury atmosphere composition of hydrogen)/(Earth atmosphere composition of hydrogen)
nitrate anion
yttrium(III) cation
chemical types of 2-aminoethanol
specific heat at STP of period 3 elements
H2O + P + HIO3 = I2 + H3PO4