Search

InChI identifier of erythorbic acid

Input interpretation

erythorbic acid | InChI identifier
erythorbic acid | InChI identifier

Result

InChI=1/C6H8O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2, 5, 7-8, 10-11H, 1H2/t2-, 5-/m1/s1
InChI=1/C6H8O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2, 5, 7-8, 10-11H, 1H2/t2-, 5-/m1/s1

Random Queries

marr edges image bikitaite
molar mass of cobalt(I) cation vs mercury(II) cation
net ionic charge of palladium(I) cation vs zirconium(IV) cation
formula of sulfuric acid vs ascorbic acid
Aufbau diagram of gaseous elements
formula of alkane functional group
alternate names of phosphorus(IV) cation
discovery year of platinum vs rhodium
SMILES identifier iodic acid
freezing point of cerium fluoride