Input interpretation
magnesium nitrate
Chemical names and formulas
formula | Mg(NO_3)_2 Hill formula | MgN_2O_6 name | magnesium nitrate IUPAC name | magnesium dinitrate alternate names | magnesium dinitrate | magnesium(II) nitrate(1:2) | nitric acid, magnesium salt mass fractions | Mg (magnesium) 16.4% | N (nitrogen) 18.9% | O (oxygen) 64.7%
Structure diagram
Structure diagram
Basic properties
molar mass | 148.31 g/mol phase | solid (at STP) melting point | 88.9 °C boiling point | 330 °C density | 1.2051 g/cm^3
Units
Solid properties (at STP)
density | 1.2051 g/cm^3
Units
Thermodynamic properties
specific heat capacity c_p | solid | 0.9568 J/(g K) molar heat capacity c_p | solid | 141.9 J/(mol K) specific free energy of formation Δ_fG° | solid | -3.974 kJ/g molar free energy of formation Δ_fG° | solid | -589.4 kJ/mol specific heat of formation Δ_fH° | solid | -5.331 kJ/g molar heat of formation Δ_fH° | solid | -790.7 kJ/mol (at STP)
Chemical identifiers
([O-])[O-].[N+](=O)([O-])[O-].[Mg+2] InChI identifier | InChI=1/Mg.2NO3/c;2*2-1(3)4/q+2;2*-1 EU number | 233-826-7 Gmelin number | 20115 RTECS number | OM3750000](../image_source/0848f7ea3c7e2197f8d816ae6764c70e.png)
CAS number | 10377-60-3 PubChem CID number | 25212 SMILES identifier | [N+](=O)([O-])[O-].[N+](=O)([O-])[O-].[Mg+2] InChI identifier | InChI=1/Mg.2NO3/c;2*2-1(3)4/q+2;2*-1 EU number | 233-826-7 Gmelin number | 20115 RTECS number | OM3750000
NFPA label
NFPA label
NFPA health rating | 1 NFPA fire rating | 0 NFPA reactivity rating | 0 NFPA hazards | oxidizing agent
Ion equivalents
Mg^(2+) (magnesium cation) | 1 (NO_3)^- (nitrate anion) | 2